CAS 193197-68-1
:TRIS[4-(TRIDECAFLUOROHEXYL)PHENYL]PHOSPHINE
Description:
TRIS[4-(tridecafluorohexyl)phenyl]phosphine is a phosphine derivative characterized by its unique structure, which includes a phosphorus atom bonded to three 4-(tridecafluorohexyl)phenyl groups. This compound is notable for its fluorinated alkyl chains, which impart hydrophobic and lipophobic properties, making it useful in various applications, including as a surfactant or in materials science. The presence of fluorinated groups enhances thermal stability and chemical resistance, while the phosphine functionality can participate in coordination chemistry, potentially forming complexes with metals. Additionally, the compound may exhibit interesting electronic properties due to the conjugated phenyl rings, which can influence its reactivity and interactions with other chemical species. Its unique characteristics make it a subject of interest in research areas such as organic synthesis, catalysis, and the development of advanced materials. Safety data should be consulted for handling, as phosphines can be toxic and require appropriate precautions.
Formula:C36H12F39P
InChI:InChI=1/C36H12F39P/c37-19(38,22(43,44)25(49,50)28(55,56)31(61,62)34(67,68)69)13-1-7-16(8-2-13)76(17-9-3-14(4-10-17)20(39,40)23(45,46)26(51,52)29(57,58)32(63,64)35(70,71)72)18-11-5-15(6-12-18)21(41,42)24(47,48)27(53,54)30(59,60)33(65,66)36(73,74)75/h1-12H
SMILES:c1cc(ccc1C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)P(c1ccc(cc1)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)c1ccc(cc1)C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Synonyms:- Tris[4-(Perfluorohexyl)Phenyl]Phosphine
- Tris[4-(Tridecafluorohexyl)Phenyl]Phosphane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

