CAS 193202-37-8

N-(2-CARBOXY-4,5-DICHLOROBENZOYL)-(-)-10,2-CAMPHORSULTAM

Description:

N-(2-Carboxy-4,5-dichlorobenzoyl)-(-)-10,2-camphorsultam is a chemical compound characterized by its unique structure, which includes a camphorsultam moiety and a dichlorobenzoic acid derivative. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in organic synthesis and medicinal chemistry due to its functional groups that may participate in various chemical reactions. The presence of the carboxylic acid group suggests it can engage in hydrogen bonding, influencing its solubility and reactivity. The dichlorobenzoyl group may impart specific electronic properties, potentially affecting its biological activity. Additionally, the chirality of the camphorsultam component indicates that the compound may exhibit stereoselective behavior in reactions or interactions with biological targets. Overall, this compound's characteristics make it of interest in research areas focused on drug development and synthetic methodologies.

Formula: C₁₈H₁₉Cl₂NO₅S

InChI: InChI=1/C18H19Cl2NO5S/c1-17(2)9-3-4-18(17)8-27(25,26)21(14(18)5-9)15(22)10-6-12(19)13(20)7-11(10)16(23)24/h6-7,9,14H,3-5,8H2,1-2H3,(H,23,24)

SMILES: CC1(C)C2CCC31CS(=O)(=O)N(C3C2)C(=O)c1cc(c(cc1C(=O)O)Cl)Cl

N-(2-CArboxy-4,5-dichlorobenzoyl)-(-)-10,2-camphorsultam

CAS: 193202-37-8

Formula: C₁₈H₁₉Cl₂NO₅S

Purity: 98%

Color and Shape: Solid

Molecular weight: 432.3182

Ref: IN-DA003S8U

N-(2-Carboxy-4,5-Dichlorobenzoyl)-(-)-10,2-Camphorsultam

CAS: 193202-37-8

N-(2-Carboxy-4,5-Dichlorobenzoyl)-(-)-10,2-Camphorsultam

Purity: 99%

Molecular weight: 432.32g/mol

Ref: 54-OR1013958

N-(2-Carboxy-4,5-dichlorobenzoyl)-(-)-10,2-camphorsultam

CAS: 193202-37-8

Formula: C₁₈H₁₉Cl₂NO₅S

Purity: >98.0%(T)(HPLC)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 432.31

Ref: 3B-C1683