CAS 19324-55-1
:(3β)-3-(Acetyloxy)pregna-5,16-diene-7,20-dione
Description:
The chemical substance known as (3β)-3-(Acetyloxy)pregna-5,16-diene-7,20-dione, with the CAS number 19324-55-1, is a synthetic steroid derivative. It features a steroid backbone, characterized by a four-ring core structure typical of steroids, which includes three cyclohexane rings and one cyclopentane ring. The presence of the acetyloxy group at the 3β position indicates that it has an acetyl functional group attached to a hydroxyl group, which can influence its biological activity and solubility. The diene structure suggests the presence of double bonds, which can affect the compound's reactivity and stability. Additionally, the keto groups at positions 7 and 20 contribute to its overall chemical properties and potential interactions in biological systems. This compound may exhibit hormonal activity, similar to other steroid derivatives, and could be of interest in pharmaceutical applications, particularly in the fields of endocrinology and reproductive health. Its specific characteristics, such as melting point, solubility, and biological activity, would require further investigation through empirical studies.
Formula:C23H30O4
InChI:InChI=1S/C23H30O4/c1-13(24)17-5-6-18-21-19(8-10-23(17,18)4)22(3)9-7-16(27-14(2)25)11-15(22)12-20(21)26/h5,12,16,18-19,21H,6-11H2,1-4H3/t16-,18-,19-,21-,22-,23+/m0/s1
InChI key:InChIKey=WANSFKJXNRSVII-GHFWAWAGSA-N
SMILES:O=C1[C@@]2([C@@]([C@]3(C)C(=C1)C[C@@H](OC(C)=O)CC3)(CC[C@@]4(C)[C@]2(CC=C4C(C)=O)[H])[H])[H]
Synonyms:- Pregna-5,16-diene-7,20-dione, 3β-hydroxy-, acetate
- 7,20-Dioxopregna-5,16-dien-3β-yl acetate
- (3β)-3-(Acetyloxy)pregna-5,16-diene-7,20-dione
- Pregna-5,16-diene-7,20-dione, 3-(acetyloxy)-, (3β)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.

