CymitQuimica logo

CAS 193269-78-2

:

1-Boc-3-(Amino)azetidine

Description:
1-Boc-3-(Amino)azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group for amines, indicating that the amino group at the 3-position of the azetidine ring is protected to prevent unwanted reactions during synthesis. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and biologically active molecules, due to its ability to serve as a building block in the construction of more complex structures. The presence of the amino group suggests potential for further functionalization, making it versatile in various chemical reactions. Additionally, the compound's stability and reactivity can be influenced by the Boc group, which can be removed under specific conditions to reveal the free amine for subsequent reactions. Overall, 1-Boc-3-(Amino)azetidine is a valuable intermediate in synthetic organic chemistry.
Formula:C8H16N2O2
InChI:InChI=1/C8H16N2O2/c1-8(2,3)12-7(11)10-4-6(9)5-10/h6H,4-5,9H2,1-3H3
InChI key:WPGLRFGDZJSQGI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CC(C1)N
Synonyms:
  • tert-Butyl 3-aminoazetidine-1-carboxylate
  • N-Boc-3-AminoAzetidine
  • N-Boc-3-amino-azetidine
  • 1-Boc-3-aminoazetidine
Found 8 products.