CAS 19327-39-0
:3,6,9,12-Tetraoxaeicosan-1-ol
Description:
3,6,9,12-Tetraoxaeicosan-1-ol, with the CAS number 19327-39-0, is a synthetic compound characterized by its long-chain structure featuring multiple ether linkages. This molecule consists of a linear carbon chain with four ether (–O–) groups interspersed, contributing to its unique properties. The presence of hydroxyl (–OH) functional group at one end of the chain enhances its solubility in polar solvents and imparts hydrophilic characteristics. This compound is typically used in various applications, including as a surfactant or emulsifier in formulations due to its ability to reduce surface tension. Its structure allows for flexibility and potential interactions with biological membranes, making it of interest in biochemical research. Additionally, the tetraoxy configuration suggests potential stability and resistance to degradation, which can be advantageous in certain industrial applications. Overall, 3,6,9,12-Tetraoxaeicosan-1-ol exemplifies a versatile chemical with properties that can be tailored for specific uses in both research and industry.
Formula:C16H34O5
InChI:InChI=1S/C16H34O5/c1-2-3-4-5-6-7-9-18-11-13-20-15-16-21-14-12-19-10-8-17/h17H,2-16H2,1H3
InChI key:InChIKey=FEOZZFHAVXYAMB-UHFFFAOYSA-N
SMILES:C(COCCCCCCCC)OCCOCCOCCO
Synonyms:- 2-[2-[2-(2-Octoxyethoxy)ethoxy]ethoxy]ethanol
- 3,6,9,12-Tetraoxaeicosan-1-ol
- 3,6,9,12-Tetraoxaicosan-1-Ol
- C8E4
- C<sub>8</sub>E<sub>4</sub>
- Ethanol, 2-[2-[2-[2-(octyloxy)ethoxy]ethoxy]ethoxy]-
- Tetraethylene glycol monooctyl ether
- Tetraethylene glycol octyl ether
- Tetraoxyethylene monooctyl ether
- n-Octyltetraoxyethylene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Tetraethylene glycol monooctyl ether
CAS:Reagent for solubilizing membrane proteinsFormula:C16H34O5Molecular weight:306.443,6,9,12-Tetraoxaicosan-1-ol
CAS:Formula:C16H34O5Purity:96%Color and Shape:LiquidMolecular weight:306.4382Tetraethylene glycol monooctyl ether
CAS:Tetraethylene glycol monooctyl etherPurity:99%Molecular weight:306.44g/molTetraethylene glycol monooctyl ether
CAS:Tetraethylene glycol monooctyl etherPurity:≥98%Molecular weight:306.44g/molTetraethylene glycol monooctyl ether
CAS:Formula:C16H34O5Purity:≥ 98.0%Color and Shape:Clear, colourless liquidMolecular weight:306.44Tetraethylene glycol monooctyl ether
CAS:Tetraethylene glycol monooctyl ether is a nonionic nonionic surfactant.Formula:C16H34O5Purity:98.56%Color and Shape:SolidMolecular weight:306.44Tetraethylene glycol monooctyl ether
CAS:Tetraethylene glycol monooctyl ether (TEGMOOE) is a surfactant and antimicrobial agent. It is a non-ionic surfactant that is used in many industrial applications, including as an emulsifier, dispersing agent, wetting agent, and defoamer. TEGMOOE has been shown to inhibit the multidrug efflux pump in some bacterial cells by binding to the signal peptide. This binding prevents the formation of an antibiotic-inhibitor complex with the enzyme cell wall synthesis that is required for cell wall biosynthesis, inhibiting protein synthesis and cell division. TEGMOOE also has been shown to have antimicrobial properties against tissue culture bacteria such as Staphylococcus aureus and Enterococcus faecalis. TEGMOOE can also be used as a calibration standard for titration calorimetry or flow systems by adding fatty acid to TEGMOOE solutionFormula:C16H34O5Purity:Min. 95%Color and Shape:LiquidMolecular weight:306.44 g/molTetraethylene glycol monooctyl ether
CAS:Controlled ProductFormula:C16H34O5Color and Shape:NeatMolecular weight:306.438n-Octyltetraoxyethylene
CAS:The tenside C8E4 solubilizes membrane proteins. The CMC value is 7.2 mM.Formula:C16H34O5Color and Shape:ColourlessMolecular weight:306.44








