CAS 19333-63-2
:Diformazan
Description:
Diformazan, with the CAS number 19333-63-2, is an organic compound characterized by its unique structure, which features two formazan groups. It is typically recognized for its deep red color, which is a result of its conjugated double bond system, making it useful as a colorimetric reagent in various analytical applications. Diformazan is often employed in biochemical assays, particularly in the determination of cell viability and metabolic activity, as it can be reduced to a colored formazan product by viable cells. This property makes it valuable in fields such as microbiology and pharmacology. The compound is soluble in organic solvents and exhibits stability under certain conditions, although it may be sensitive to light and heat. Additionally, its synthesis usually involves the reaction of hydrazine derivatives with carbonyl compounds, leading to the formation of the formazan structure. Overall, diformazan serves as an important tool in laboratory settings for quantitative analysis and research purposes.
Formula:C40H30N12O10
InChI:InChI=1/C40H30N12O10/c1-61-37-23-27(7-21-35(37)43-47-39(25-3-13-31(14-4-25)49(53)54)45-41-29-9-17-33(18-10-29)51(57)58)28-8-22-36(38(24-28)62-2)44-48-40(26-5-15-32(16-6-26)50(55)56)46-42-30-11-19-34(20-12-30)52(59)60/h3-24,41-42H,1-2H3/b45-39-,46-40-,47-43+,48-44+
Synonyms:- TNBT Diformazan
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.

