CAS 193340-04-4

1-Methyl 2-[(carboxymethyl)sulfonyl]acetate

Description:

1-Methyl 2-[(carboxymethyl)sulfonyl]acetate, identified by its CAS number 193340-04-4, is an organic compound characterized by its functional groups, which include an acetate and a sulfonyl moiety. This compound typically exhibits properties associated with both esters and sulfonic acids, making it polar and soluble in water and organic solvents. Its structure suggests potential reactivity due to the presence of the carboxymethyl group, which can participate in various chemical reactions, including esterification and nucleophilic substitutions. The sulfonyl group contributes to its acidity and may enhance its biological activity, making it of interest in pharmaceutical and agrochemical applications. Additionally, the methyl group can influence the compound's steric properties and overall stability. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, 1-Methyl 2-[(carboxymethyl)sulfonyl]acetate is a versatile compound with potential applications in various fields, including medicinal chemistry and materials science.

Formula: C₅H₈O₆S

InChI: InChI=1S/C5H8O6S/c1-11-5(8)3-12(9,10)2-4(6)7/h2-3H2,1H3,(H,6,7)

InChI key: InChIKey=KHGVWLXLOVXUQP-UHFFFAOYSA-N

SMILES: S(CC(OC)=O)(CC(O)=O)(=O)=O

Synonyms:

• 2-(2-Methoxy-2-oxoethanesulfonyl)acetic acid
• Acetic acid, 2-[(carboxymethyl)sulfonyl]-, 1-methyl ester
• 1-Methyl 2-[(carboxymethyl)sulfonyl]acetate
• Acetic acid, [(carboxymethyl)sulfonyl]-, 1-methyl ester
• 2-((2-Methoxy-2-oxoethyl)sulfonyl)acetic acid

2-(2-Methoxy-2-oxoethanesulfonyl)acetic acid

CAS: 193340-04-4

Versatile small molecule scaffold

Formula: C₅H₈O₆S

Purity: Min. 95%

Molecular weight: 196.18 g/mol

Ref: 3D-THA34004