CAS 193353-34-3
:2,5-Difluorobenzeneboronic acid
Description:
2,5-Difluorobenzeneboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a benzene ring that has two fluorine substituents at the 2 and 5 positions. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the boronic acid group, which can engage in hydrogen bonding. The presence of fluorine atoms enhances the compound's reactivity and can influence its electronic properties, making it useful in various applications, including medicinal chemistry and materials science. Boronic acids are known for their ability to form reversible covalent bonds with diols, which is a key feature in applications such as drug delivery and sensor development. Additionally, 2,5-Difluorobenzeneboronic acid can serve as a building block in organic synthesis, particularly in Suzuki coupling reactions, which are widely used for the formation of carbon-carbon bonds. Its unique structure and reactivity make it a valuable compound in both research and industrial applications.
Formula:C6H5FN2O2
InChI:InChI=1/C6H5FN2O2/c1-4-2-3-8-6(7)5(4)9(10)11/h2-3H,1H3
Synonyms:- 2,5-Difluorophenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,5-Difluorophenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C6H5BF2O2Color and Shape:White to Light yellow powder to crystalMolecular weight:157.912,5-Difluorobenzeneboronic acid, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C6H5BF2O2Purity:96%Color and Shape:Crystals or powder or crystalline powder or fused solid, White to cream to pale grayMolecular weight:157.912,5-Difluorophenylboronic acid
CAS:Formula:C6H5BF2O2Purity:97%Color and Shape:SolidMolecular weight:157.91052,5-Difluorobenzeneboronic acid
CAS:<p>2,5-Difluorobenzeneboronic acid</p>Formula:C6H5BF2O2Purity:98%Color and Shape: white solidMolecular weight:157.91g/mol2,5-Difluorophenylboronic acid
CAS:Formula:C6H5BF2O2Purity:97%Color and Shape:CrystallineMolecular weight:157.91





