CymitQuimica logo

CAS 193357-81-2

:

Piperidine, 4-[[4-(trifluoromethyl)phenyl]methyl]-, hydrochloride

Description:
Piperidine, 4-[[4-(trifluoromethyl)phenyl]methyl]-, hydrochloride is a chemical compound characterized by its piperidine core, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a trifluoromethyl group on the phenyl ring enhances its lipophilicity and can influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having specific pharmacological effects, although detailed biological activity would depend on further studies. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as compounds with trifluoromethyl groups can exhibit unique toxicological profiles. Overall, this compound represents a class of substances that may have significant utility in research and development within the fields of chemistry and pharmacology.
Formula:C13H16F3N・ClH
InChI:InChI=1S/C13H16F3N.ClH/c14-13(15,16)12-3-1-10(2-4-12)9-11-5-7-17-8-6-11;/h1-4,11,17H,5-9H2;1H
InChI key:GHUPEZITEAKUTG-UHFFFAOYSA-N
SMILES:C1CNCCC1CC2=CC=C(C=C2)C(F)(F)F.Cl
Found 3 products.