CAS 19343-78-3: 1,2,3,4-tetrahydro-4-methylquinoline
Description:1,2,3,4-Tetrahydro-4-methylquinoline is a bicyclic organic compound characterized by a fused ring structure that includes a quinoline moiety. It features a saturated tetrahydro framework, which contributes to its stability and reactivity. The presence of a methyl group at the 4-position of the quinoline ring influences its chemical properties, such as solubility and reactivity with electrophiles. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure allows for various functionalization possibilities, which can be explored for developing new compounds with desired properties. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H13N
InChI:InChI=1S/C10H13N/c1-8-6-7-11-10-5-3-2-4-9(8)10/h2-5,8,11H,6-7H2,1H3
InChI key:InChIKey=OXNZWCYNCDWCJA-UHFFFAOYSA-N
SMILES:C=1C=CC2=C(C1)NCCC2C
- Synonyms:
- 1,2,3,4-Tetrahydrolepidine
- 4-Methyl-1,2,3,4-tetrahydroquinoline
- Ai3-22251
- Lepidine, 1,2,3,4-tetrahydro-
- Quinoline, 1,2,3,4-tetrahydro-4-methyl-
- 1,2,3,4-Tetrahydro-4-methylquinoline
- 1,2,3,4-Tetrahydro-4-methylquinoline
4-Methyl-1,2,3,4-tetrahydroquinoline
Ref: IN-DA00343L
| 1g | 177.00 € | ||
| 5g | 607.00 € | ||
| 100mg | 59.00 € | ||
| 250mg | 85.00 € |
Ref: 54-OR930852
| 1g | 244.00 € | ||
| 5g | 763.00 € | ||
| 100mg | 86.00 € | ||
| 250mg | 103.00 € |
4-Methyl-1,2,3,4-tetrahydroquinoline
Ref: 10-F320047
| 1g | To inquire | ||
| 250mg | 60.00 € |
4-Methyl-1,2,3,4-tetrahydroquinoline
Ref: 3D-UAA34378
| 2500mg | 410.00 € |
