CAS 193480-40-9

1H-Imidazol-2-amine, 1-[(4-fluorophenyl)methyl]-

Description:

1H-Imidazol-2-amine, 1-[(4-fluorophenyl)methyl]- is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This specific derivative features a 4-fluorobenzyl group attached to the imidazole nitrogen, enhancing its potential for biological activity. The presence of the fluorine atom can influence the compound's lipophilicity and metabolic stability, making it of interest in medicinal chemistry. Typically, compounds like this may exhibit properties such as being a potential ligand for various biological targets, including enzymes or receptors. The imidazole moiety is known for its role in various biological processes and can participate in hydrogen bonding, which is crucial for interactions with biomolecules. Additionally, the compound's solubility, stability, and reactivity can be influenced by the substituents on the imidazole ring and the phenyl group. Overall, this compound may have applications in pharmaceuticals, particularly in the development of new therapeutic agents.

Formula: C₁₀H₁₀FN₃

InChI: InChI=1S/C10H10FN3/c11-9-3-1-8(2-4-9)7-14-6-5-13-10(14)12/h1-6H,7H2,(H2,12,13)

InChI key: InChIKey=YFCHRILUFPYHSR-UHFFFAOYSA-N

SMILES: C(N1C(N)=NC=C1)C2=CC=C(F)C=C2

Synonyms:

• 1-[(4-Fluorophenyl)methyl]-1H-imidazol-2-amine
• 1-[(4-Fluorophenyl)methyl]imidazol-2-amine
• 1-(4-Fluorobenzyl)-1H-imidazol-2-amine
• 1H-Imidazol-2-amine, 1-[(4-fluorophenyl)methyl]-

1-(4-Fluorobenzyl)-1h-imidazol-2-amine

CAS: 193480-40-9

Formula: C₁₀H₁₀FN₃

Molecular weight: 191.2049

Ref: IN-DA01DW47

1-(4-Fluorobenzyl)-1H-imidazol-2-amine

CAS: 193480-40-9

Formula: C₁₀H₁₀FN₃

Molecular weight: 191.209

Ref: 10-F358513

1-[(4-Fluorophenyl)methyl]-1H-imidazol-2-amine

CAS: 193480-40-9

Versatile small molecule scaffold

Formula: C₁₀H₁₀FN₃

Purity: Min. 95%

Molecular weight: 191.2 g/mol

Ref: 3D-THA48040