CAS 19352-29-5

3-PHENYL-4-PICOLINE

Description:

3-Phenyl-4-picoline, with the CAS number 19352-29-5, is an organic compound that belongs to the class of pyridine derivatives. It features a pyridine ring substituted with a phenyl group at the 3-position and a methyl group at the 4-position. This compound is characterized by its aromatic nature, which contributes to its stability and potential reactivity. It typically appears as a colorless to pale yellow liquid or solid, depending on the specific conditions. The presence of the nitrogen atom in the pyridine ring imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions. 3-Phenyl-4-picoline may exhibit biological activity, making it of interest in pharmaceutical research. Its solubility in organic solvents and limited solubility in water are typical for such compounds, influencing its applications in organic synthesis and material science. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.

Formula: C₁₂H₁₁N

InChI: InChI=1/C12H11N/c1-10-7-8-13-9-12(10)11-5-3-2-4-6-11/h2-9H,1H3

SMILES: Cc1ccncc1c1ccccc1

Synonyms:

• 4-Methyl-3-Phenylpyridine

4-Methyl-3-phenylpyridine

CAS: 19352-29-5

Formula: C₁₂H₁₁N

Purity: 97%

Color and Shape: Liquid

Molecular weight: 169.2224

Ref: IN-DA007QYC

4-Methyl-3-phenylpyridine

CAS: 19352-29-5

4-Methyl-3-phenylpyridine is a pyridine derivative widely used in biochemical experiments and drug synthesis research.

Formula: C₁₂H₁₁N

Purity: 99.87%

Color and Shape: Solid

Molecular weight: 169.22

Ref: TM-TN9255

4-Methyl-3-phenylpyridine

CAS: 19352-29-5

4-Methyl-3-phenylpyridine

Purity: 97%

Molecular weight: 169.23g/mol

Ref: 54-OR1058226

4-Methyl-3-phenylpyridine

CAS: 19352-29-5

Formula: C₁₂H₁₁N

Purity: ≥97%

Color and Shape: Liquid

Molecular weight: 169.227

Ref: 10-F324507