CAS 19357-45-0
:17-(Acetyloxy)-21-hydroxypregn-4-ene-3,20-dione
Description:
The chemical substance known as 17-(Acetyloxy)-21-hydroxypregn-4-ene-3,20-dione, with the CAS number 19357-45-0, is a synthetic steroid that belongs to the class of corticosteroids. It is characterized by its structural features, which include a pregnane backbone with specific functional groups: an acetyloxy group at the 17-position and a hydroxyl group at the 21-position. This compound exhibits anti-inflammatory and immunosuppressive properties, making it useful in various therapeutic applications, particularly in the treatment of conditions such as allergies, asthma, and autoimmune disorders. The presence of the acetyloxy group enhances its lipophilicity, potentially affecting its pharmacokinetics and bioavailability. Additionally, its steroidal structure allows it to interact with glucocorticoid receptors, influencing gene expression and cellular responses. As with many corticosteroids, careful consideration of dosage and potential side effects is essential in clinical use. Overall, this compound exemplifies the diverse applications of synthetic steroids in medicine.
Formula:C23H32O5
InChI:InChI=1/C23H32O5/c1-14(25)28-23(20(27)13-24)11-8-19-17-5-4-15-12-16(26)6-9-21(15,2)18(17)7-10-22(19,23)3/h12,17-19,24H,4-11,13H2,1-3H3/t17-,18+,19+,21+,22+,23+/m1/s1
InChI key:InChIKey=MNQKQGFLLDOCEI-JZTHCNPZSA-N
SMILES:C(CO)(=O)[C@]1(OC(C)=O)[C@]2(C)[C@@](CC1)([C@]3([C@](CC2)([C@]4(C)C(CC3)=CC(=O)CC4)[H])[H])[H]
Synonyms:- Cortexolone 17-acetate
- 17,21-Dihydroxypregn-4-ene-3,20-dione 17-acetate
- 21-hydroxy-3,20-dioxopregn-4-en-17-yl acetate
- 17-Acetoxy-21-hydroxypregn-4-ene-3,20-dione
- Pregn-4-ene-3,20-dione, 17-(acetyloxy)-21-hydroxy-
- 17-(Acetyloxy)-21-hydroxypregn-4-ene-3,20-dione
- Pregn-4-ene-3,20-dione, 17,21-dihydroxy-, 17-acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
