CAS 19360-72-6
:Biflavanone GB-1a
Description:
Biflavanone GB-1a, with the CAS number 19360-72-6, is a synthetic biflavonoid compound that exhibits a range of interesting biological activities. Biflavonoids are characterized by their structure, which consists of two flavonoid units linked together. This compound is known for its potential antioxidant properties, which can help in neutralizing free radicals and reducing oxidative stress in biological systems. Additionally, Biflavanone GB-1a may exhibit anti-inflammatory and anti-cancer activities, making it a subject of interest in pharmacological research. Its solubility and stability can vary depending on the solvent and environmental conditions, which is important for its application in various formulations. As with many flavonoids, it may also interact with various biological pathways, influencing cellular signaling and gene expression. However, further studies are necessary to fully elucidate its mechanisms of action and potential therapeutic applications. Safety and toxicity profiles should also be considered when evaluating its use in any practical applications.
Formula:C30H22O10
InChI:InChI=1S/C30H22O10/c31-15-5-1-13(2-6-15)22-12-21(37)24-19(35)11-20(36)26(30(24)39-22)27-28(38)25-18(34)9-17(33)10-23(25)40-29(27)14-3-7-16(32)8-4-14/h1-11,22,27,29,31-36H,12H2/t22-,27-,29+/m0/s1
InChI key:InChIKey=MXEIKUWMKSYEII-DETITRACSA-N
SMILES:O=C1[C@@H]([C@H](OC=2C1=C(O)C=C(O)C2)C3=CC=C(O)C=C3)C4=C5C(C(=O)C[C@H](O5)C6=CC=C(O)C=C6)=C(O)C=C4O
Synonyms:- (2S,2′S,3R)-2,2′,3,3′-Tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)[3,8′-bi-4H-1-benzopyran]-4,4′-dione
- GB 1a
- [3,8′-Bi-4H-1-benzopyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)-, [2S-[2α,3β(R*)]]-
- [3,8′-Bi-4H-1-benzopyran]-4,4′-dione, 2,2′,3,3′-tetrahydro-5,5′,7,7′-tetrahydroxy-2,2′-bis(4-hydroxyphenyl)-, (2S,2′S,3R)-
- Biflavanone GB-1a
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
[3,8'-Bi-4H-1-benzopyran]-4,4'-dione,2,2',3,- 3'-tetrahydro-5,5',7,7'-tetrahydroxy-2,2'-bis- (4-hydroxyphenyl)-,(2S,2'S,3R)-
CAS:Formula:C30H22O10Molecular weight:542.4897GB 1b
CAS:GB 1b is a natural product isolated from the leaves of Garcinia travancorica.Formula:C30H22O10Purity:98%Color and Shape:SolidMolecular weight:542.493,8''-Binaringenin
CAS:<p>3,8''-Binaringenin is a flavonoid compound, which is a type of polyphenolic compound known for its involvement in plant defense mechanisms. It is sourced primarily from various plant species, where it plays a role in protection against pathogens and environmental stressors. As a flavonoid, 3,8''-Binaringenin exhibits a mode of action that includes antioxidant activity, whereby it neutralizes free radicals and reduces oxidative stress. Additionally, it may modulate enzyme activities, influencing various biological pathways.</p>Formula:C30H22O10Purity:Min. 95%Molecular weight:542.50 g/mol



