CAS 19363-94-1
:2-(2'-AMINOETHYL)-6-METHYLPYRIDINE
Description:
2-(2'-Aminoethyl)-6-methylpyridine, with the CAS number 19363-94-1, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an aminoethyl side chain at the 2-position and a methyl group at the 6-position of the pyridine ring. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the amino group imparts basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its solubility in polar solvents, such as water and alcohols, is notable due to the amino group, which can engage in hydrogen bonding. This compound may be used in the synthesis of pharmaceuticals, agrochemicals, or as a ligand in coordination chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H12N2
InChI:InChI=1/C8H12N2/c1-7-3-2-4-8(10-7)5-6-9/h2-4H,5-6,9H2,1H3
SMILES:Cc1cccc(CCN)n1
Synonyms:- Rarechem An Ka 0157
- 6-Methyl-2-Pyridineethanamine
- Chembrdg-Bb 4002941
- 2-(6-Methylpyridin-2-Yl)Ethanamine
- 6-Methyl-2-Pyridineethylamine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(6-Methylpyridin-2-yl)ethanamine
CAS:2-(6-Methylpyridin-2-yl)ethanamine
Molecular weight:136.19g/mol[2-(6-Methylpyridin-2-yl)ethyl]amine
CAS:2-(6-Methylpyridin-2-yl)ethyl]amine is a reagent that is used as a building block for the synthesis of heterocycles. It is used in the preparation of various complex compounds, such as 2-(6-methylpyridin-2-yl)ethylamine hydrochloride, 2-(6-methylpyridin-2-yl)ethylamine hydrobromide, and 2-[(6-methylpyridin-2-yl)ethyl]amine hydrochloride. This chemical can be used as an intermediate in the synthesis of fine chemicals or speciality chemicals. It has CAS No. 19363-94-1 and is an important research chemical with versatile uses in organic synthesis reactions.Formula:C8H12N2Purity:Min. 95%Color and Shape:Colourless LiquidMolecular weight:136.19 g/mol2-(6-methylpyridin-2-yl)ethanamine
CAS:Formula:C8H12N2Purity:95.0%Color and Shape:LiquidMolecular weight:136.198



