CAS 19368-25-3

2-[[(3,5-Dichlorophenyl)amino]carbonyl]benzoic acid

Description:

2-[[(3,5-Dichlorophenyl)amino]carbonyl]benzoic acid, identified by its CAS number 19368-25-3, is a chemical compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which contributes to its acidity and potential for forming salts or esters. The presence of the 3,5-dichlorophenyl group indicates that the compound has two chlorine substituents on the phenyl ring, which can influence its reactivity and biological activity. The amino group attached to the carbonyl carbon suggests that it may participate in hydrogen bonding, enhancing its solubility in polar solvents. This compound may exhibit properties typical of both carboxylic acids and amines, making it potentially useful in various chemical reactions, including synthesis and medicinal chemistry. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's unique structure positions it for potential applications in pharmaceuticals or agrochemicals.

Formula: C₁₄H₉Cl₂NO₃

InChI: InChI=1S/C14H9Cl2NO3/c15-8-5-9(16)7-10(6-8)17-13(18)11-3-1-2-4-12(11)14(19)20/h1-7H,(H,17,18)(H,19,20)

InChI key: InChIKey=KJJDJHRRNYTTRI-UHFFFAOYSA-N

SMILES: C(NC1=CC(Cl)=CC(Cl)=C1)(=O)C2=C(C(O)=O)C=CC=C2

Synonyms:

• Benzoic acid, 2-[[(3,5-dichlorophenyl)amino]carbonyl]-
• 2-[[(3,5-Dichlorophenyl)amino]carbonyl]benzoic acid
• 2-[(3,5-Dichlorophenyl)carbamoyl]benzoic acid
• Phthalanilic acid, 3′,5′-dichloro-