CAS 19369-53-0

2-AMINO-5-METHYL-THIOPHENE-3-CARBOXYLIC ACID METHYL ESTER

Description:

2-Amino-5-methyl-thiophene-3-carboxylic acid methyl ester, with the CAS number 19369-53-0, is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. This compound features an amino group (-NH2) and a carboxylic acid moiety that is esterified with a methyl group, contributing to its reactivity and solubility properties. The presence of the methyl group at the 5-position of the thiophene ring enhances its hydrophobic characteristics, while the amino and ester functionalities provide sites for potential chemical reactivity, making it useful in various synthetic applications. Typically, compounds of this nature are of interest in medicinal chemistry and materials science due to their biological activity and ability to serve as intermediates in the synthesis of more complex molecules. Additionally, the compound may exhibit specific physical properties such as melting point, boiling point, and solubility that are influenced by its molecular structure and functional groups.

Formula: C₇H₉NO₂S

InChI: InChI=1/C7H9NO2S/c1-4-3-5(6(8)11-4)7(9)10-2/h3H,8H2,1-2H3

SMILES: Cc1cc(c(N)s1)C(=O)OC

Synonyms:

• 2-Amino-6-Methylthiophene-3-Carboxylate
• Methyl 2-Amino-5-Methylthiophene-3-Carboxylate

Methyl 2-amino-5-methylthiophene-3-carboxylate

CAS: 19369-53-0

Formula: C₇H₉NO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 171.2169

Ref: IN-DA0074YY

Methyl 2-Amino-5-methylthiophene-3-carboxylate

CAS: 19369-53-0

Methyl 2-Amino-5-methylthiophene-3-carboxylate

Purity: 96%

Molecular weight: 171.22g/mol

Ref: 54-OR1013789

2-Amino-5-methyl-thiophene-3-carboxylic acid methyl ester

CAS: 19369-53-0

Formula: C₇H₉NO₂S

Purity: 96%

Color and Shape: Solid

Molecular weight: 171.21

Ref: 10-F014037

Methyl 2-Amino-5-methylthiophene-3-carboxylate

Controlled Product

CAS: 19369-53-0

Applications Methyl 2-Amino-5-methylthiophene-3-carboxylate is used as a starting reagent in the synthesis of Thieno[2,3-b]Pyridinones and 4-Hydroxy-6-oxo-6,7-dihydro-thieno[2,3-b]pyridine derivatives, compounds that act as cytoprotectants and inhibitors of the N-Methyl-D-aspartate (NMDA) receptor.
References Buchstaller, H., et al.: J. Med. Chem., 49, 864 (2006); Hwang, K., et al.: Arch. Pharm. Res., 24, 270 (2001)

Formula: C₇H₉NO₂S

Color and Shape: Neat

Molecular weight: 171.22

Ref: TR-M286865