CAS 19370-34-4: 1-(1-Methylpropyl)-2-nitrobenzene

Description:1-(1-Methylpropyl)-2-nitrobenzene, also known as 2-nitro-1-isobutylbenzene, is an organic compound characterized by a nitro group (-NO2) attached to a benzene ring, which also bears an isobutyl substituent. This compound typically appears as a yellow to brown liquid or solid, depending on the temperature and purity. It is known for its aromatic properties and is often used in organic synthesis and as an intermediate in the production of various chemicals. The presence of the nitro group contributes to its reactivity, making it a potential candidate for electrophilic substitution reactions. Additionally, the isobutyl group influences its physical properties, such as boiling point and solubility, which can vary based on the molecular interactions within the compound. Safety data indicates that it should be handled with care due to potential toxicity and environmental hazards. Proper storage and handling procedures are essential to minimize risks associated with exposure.

Formula:C₁₀H₁₃NO₂

InChI:InChI=1S/C10H13NO2/c1-3-8(2)9-6-4-5-7-10(9)11(12)13/h4-8H,3H2,1-2H3

InChI key:InChIKey=GMQQDASXGTUDPJ-UHFFFAOYSA-N

SMILES:O=N(=O)C=1C=CC=CC1C(C)CC

Synonyms:
1-(1-Methylpropyl)-2-nitrobenzene
1-(Butan-2-Yl)-2-Nitrobenzene
Benzene, 1-(1-methylpropyl)-2-nitro-
Benzene, 1-sec-butyl-2-nitro-
1-sec-Butyl-2-nitrobenzene

Found 5 products.

Product data	Purity	Price range	Estimated delivery
1-sec-Butyl-2-nitrobenzene REF: 3B-B2427CAS: 19370-34-4	>98.0%(GC)	212.00 €	Wed 09 Apr 25
1-(sec-Butyl)-2-nitrobenzene REF: IN-DA003ENJCAS: 19370-34-4	98%	160.00 €~309.00 €	Wed 16 Apr 25
1-Sec-butyl-2-nitrobenzene REF: 54-OR937123CAS: 19370-34-4	95%	194.00 €~935.00 €	Wed 23 Apr 25
1-(Sec-butyl)-2-nitrobenzene REF: 10-F721715CAS: 19370-34-4	95+%	To inquire	Mon 28 Apr 25
1-sec-Butyl-2-nitrobenzene REF: 3D-UAA37034CAS: 19370-34-4	Min. 95%	- - -	Discontinued product