CAS 19372-44-2: 2,4-Pentanedione, ion(1-), calcium salt (2:1)
Description:2,4-Pentanedione, ion(1-), calcium salt (2:1), with CAS number 19372-44-2, is a coordination compound formed from the calcium salt of the anionic form of 2,4-pentanedione, also known as acetylacetone. This compound typically exhibits characteristics such as being a white to off-white solid, which is soluble in polar solvents like water and alcohols due to its ionic nature. The calcium ion provides stability and solubility, allowing it to participate in various chemical reactions, particularly in coordination chemistry. The anionic form of 2,4-pentanedione can chelate metal ions, making this compound useful in applications such as catalysis, as a reagent in organic synthesis, and in the preparation of metal complexes. Additionally, it may exhibit properties such as moderate thermal stability and potential reactivity with other metal ions, which can influence its behavior in different chemical environments. Overall, this compound serves as an important building block in both industrial and laboratory settings.
Formula:C5H7O2Ca
InChI:InChI=1S/C5H7O2.Ca/c1-4(6)3-5(2)7;/h3H,1-2H3;/q-1;+2
InChI key:InChIKey=CVKLJNZPNLIMCK-UHFFFAOYSA-N
SMILES:[Ca+2].O=C([CH-]C(=O)C)C
- Synonyms:
- (T-4)-Bis(2,4-pentanedionato-κO<sup>2</sup>,κO<sup>4</sup>)calcium
- 2,4-Pentanedione, ion(1-), calcium
- 2,4-Pentanedione, ion(1-), calcium salt (2:1)
- Acetylacetone calcium salt
- Bis(2,4-pentadionato)calcium
- Bis(2,4-pentanedionato)calcium
- Bis(acetylacetonate)calcium
- Bis(acetylacetonyl)calcium
- Bisacetylacetonatocalcium
- Ca Acetyl Acetonate
- See more synonyms
- Ca.Ac.Ac
- Calcium Acetylactonate
- Calcium acetylacetonate
- Calcium acetylacetonate hydrate
- Calcium bis(acetylacetonate)
- Calcium, bis(2,4-pentanedionato)-
- NSC 164941
- Rhodiastab-X 77
- calcium bis[(2Z)-4-oxopent-2-en-2-olate]
