CAS 19372-80-6

Chlorodiethylaniline; 98%

Description:

Chlorodiethylaniline, with the CAS number 19372-80-6, is an organic compound characterized by the presence of both chlorine and an aniline functional group. It typically appears as a colorless to pale yellow liquid and is known for its aromatic properties. The compound features two ethyl groups attached to the nitrogen atom of the aniline structure, which influences its solubility and reactivity. Chlorodiethylaniline is primarily used in the synthesis of dyes, pharmaceuticals, and agrochemicals. It exhibits moderate toxicity, necessitating careful handling and appropriate safety measures during use. The compound is also sensitive to light and moisture, which can affect its stability. In terms of chemical behavior, it can undergo typical electrophilic aromatic substitution reactions due to the presence of the aniline moiety, making it a versatile intermediate in organic synthesis. Proper storage conditions and adherence to safety guidelines are essential to mitigate any potential hazards associated with its use.

Formula: C₁₀H₁₄ClN

InChI: InChI=1/C10H14ClN/c1-3-12(4-2)10-8-6-5-7-9(10)11/h5-8H,3-4H2,1-2H3

SMILES: CCN(CC)c1ccccc1Cl

Synonyms:

• 2-Chloro-N,N-diethylaniline

2-Chloro-N,N-diethylaniline

CAS: 19372-80-6

Formula: C₁₀H₁₄ClN

Molecular weight: 183.6779

Ref: IN-DA003H2T

2-Chloro-N,N-diethylaniline

CAS: 19372-80-6

Formula: C₁₀H₁₄ClN

Purity: >98.0%(GC)

Color and Shape: Colorless to Yellow to Orange clear liquid

Molecular weight: 183.68

Ref: 3B-C0154

2-Chloro-n,n-diethylaniline

CAS: 19372-80-6

2-Chloro-n,n-diethylaniline

Purity: 95%

Molecular weight: 183.68g/mol

Ref: 54-OR936656