CymitQuimica logo

CAS 19374-46-0

:

(1R,2r,3S)-1,2,3-trimethylcyclopentane

Description:
(1R,2R,3S)-1,2,3-trimethylcyclopentane is a cyclic hydrocarbon characterized by its unique stereochemistry and structural configuration. This compound features a cyclopentane ring with three methyl groups attached at the first, second, and third carbon atoms, contributing to its branched structure. The specific stereochemical designations (1R, 2R, 3S) indicate the spatial arrangement of the substituents around the chiral centers, which can influence the compound's physical and chemical properties, such as boiling point, melting point, and reactivity. As a saturated hydrocarbon, it is non-polar and relatively hydrophobic, making it less soluble in water but soluble in organic solvents. Its structural complexity may lead to interesting interactions in chemical reactions, particularly in organic synthesis and materials science. Additionally, the compound's conformation can affect its stability and behavior in various environments, making it a subject of interest in both theoretical and applied chemistry.
Formula:C8H16
InChI:InChI=1/C8H16/c1-6-4-5-7(2)8(6)3/h6-8H,4-5H2,1-3H3/t6-,7+,8+
Synonyms:
  • Cyclopentane, 1,2,3-Trimethyl-, (1Α,2Β,3Α)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • 1-cis-2-trans-3-Trimethylcyclopentane

    Controlled Product
    CAS:
    Formula:C8H16
    Color and Shape:Neat
    Molecular weight:112.21

    Ref: TR-T796075

    250mg
    8,684.00€