
CAS 19377-73-2
:α-Hydroxy-2-furanacetic acid
Description:
α-Hydroxy-2-furanacetic acid, with the CAS number 19377-73-2, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing oxygen. This compound features a hydroxyl group (-OH) and a carboxylic acid group (-COOH) attached to the furan ring, contributing to its reactivity and solubility in polar solvents. It is typically a white to off-white crystalline solid, and its molecular structure allows for potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of both the hydroxyl and carboxylic acid functional groups suggests that it may exhibit properties such as acidity and the ability to participate in hydrogen bonding, which can influence its behavior in biological systems. Additionally, α-Hydroxy-2-furanacetic acid may serve as an intermediate in organic synthesis or as a building block for more complex molecules. Its stability and reactivity can vary depending on environmental conditions, such as pH and temperature.
Formula:C6H6O4
InChI:InChI=1S/C6H6O4/c7-5(6(8)9)4-2-1-3-10-4/h1-3,5,7H,(H,8,9)
InChI key:InChIKey=RTLDJXGEOSVJEX-UHFFFAOYSA-N
SMILES:C(C(O)=O)(O)C1=CC=CO1
Synonyms:- 2-Hydroxy-2-(2-furanyl)ethanoic acid
- 2-(2-Furyl)glycolic acid
- α-Hydroxy-2-furanacetic acid
- 2-Furanacetic acid, α-hydroxy-
- 2-Furanglycolic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
