CAS 1938-32-5
:5-(Chloromethyl)-6-propyl-1,3-benzodioxole
Description:
5-(Chloromethyl)-6-propyl-1,3-benzodioxole, with the CAS number 1938-32-5, is an organic compound characterized by its unique structure that includes a benzodioxole moiety. This compound features a chloromethyl group and a propyl substituent, which contribute to its chemical reactivity and potential applications. The presence of the chloromethyl group suggests that it can participate in nucleophilic substitution reactions, making it a useful intermediate in organic synthesis. The benzodioxole structure is known for its stability and can exhibit interesting biological activities, which may include antioxidant or antimicrobial properties. Additionally, the propyl group can influence the lipophilicity of the compound, affecting its solubility and interaction with biological membranes. Overall, 5-(Chloromethyl)-6-propyl-1,3-benzodioxole is a compound of interest in both synthetic organic chemistry and potential pharmacological applications, although specific biological effects and safety profiles would require further investigation.
Formula:C11H13ClO2
InChI:InChI=1S/C11H13ClO2/c1-2-3-8-4-10-11(14-7-13-10)5-9(8)6-12/h4-5H,2-3,6-7H2,1H3
InChI key:InChIKey=HERYYLFZPLNJDW-UHFFFAOYSA-N
SMILES:C(CC)C=1C=C2C(=CC1CCl)OCO2
Synonyms:- 1,3-Benzodioxole, 5-(Chloromethyl)-6-Propyl-
- 217-715-0
- Toluene, .alpha.-chloro-4,5-(methylenedioxy)-2-propyl-
- Toluene, α-chloro-4,5-(methylenedioxy)-2-propyl-
- 5-(Chloromethyl)-6-propyl-1,3-benzodioxole
- 5-(Chloromethyl)-6-propyl-1,3-benzodioxole
- 5-chloromethyl-6-propyl-1,3-benzodioxole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(Chloromethyl)-6-propylbenzo[d][1,3]dioxole
CAS:Controlled ProductFormula:C11H13ClO2Color and Shape:NeatMolecular weight:212.673
