CAS 193811-33-5
:(4R,5S,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-{[(3R)-5-oxopyrrolidin-3-yl]sulfanyl}-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid
Description:
The chemical substance with the name "(4R,5S,6S)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-3-{[(3R)-5-oxopyrrolidin-3-yl]sulfanyl}-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid" and CAS number "193811-33-5" is a complex organic compound characterized by its bicyclic structure and multiple stereocenters, which contribute to its specific three-dimensional configuration. This compound features a carboxylic acid functional group, a ketone, and a thioether linkage, indicating potential reactivity and biological activity. The presence of a pyrrolidine ring suggests that it may interact with biological systems, possibly exhibiting pharmacological properties. Its stereochemistry, denoted by the R and S designations, is crucial for its biological activity, as the spatial arrangement of atoms can significantly influence how the molecule interacts with biological targets. Overall, this compound is of interest in medicinal chemistry and may have applications in drug development, particularly in the context of antibiotic or antiviral agents. Further studies would be necessary to elucidate its specific properties and potential uses.
Formula:C14H18N2O5S
InChI:InChI=1/C14H18N2O5S/c1-5-10-9(6(2)17)13(19)16(10)11(14(20)21)12(5)22-7-3-8(18)15-4-7/h5-7,9-10,17H,3-4H2,1-2H3,(H,15,18)(H,20,21)/t5-,6-,7-,9-,10-/m1/s1
SMILES:C[C@@H]1[C@@H]2[C@@H]([C@@H](C)O)C(=O)N2C(=C1S[C@@H]1CC(=NC1)O)C(=O)O
Synonyms:- (+)-(4R,5S,6S)-6-[(1R)-1-Hydroxyethyl]-4-methyl-7-oxo-3-[[(3R)-5-oxopyrrolidin-3-yl]sulfanyl]-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
tacapenem
CAS:Tacapenem is a β-lactam class antibacterial. It exhibits broad-spectrum antibacterial activity and it is highly stable to β-lactamases.Formula:C14H18N2O5SColor and Shape:SolidMolecular weight:326.37

