CAS 193887-44-4
:fmoc-L-beta-homoleucine
Description:
Fmoc-L-beta-homoleucine is a derivative of the amino acid homoleucine, characterized by the presence of a 9-fluorenylmethoxycarbonyl (Fmoc) protective group. This compound is primarily used in peptide synthesis, particularly in solid-phase peptide synthesis (SPPS), where the Fmoc group serves as a temporary protecting group for the amino group of the amino acid. The beta-homoleucine structure indicates that the amino group is located on the beta carbon relative to the carboxylic acid group, which can influence the steric and electronic properties of the molecule. Fmoc-L-beta-homoleucine is typically a white to off-white solid and is soluble in organic solvents like dimethylformamide (DMF) and dimethyl sulfoxide (DMSO), but less soluble in water. Its use in research and pharmaceutical applications is significant due to its role in the synthesis of peptides that may exhibit unique biological activities. Proper handling and storage conditions are essential to maintain its stability and reactivity during synthesis processes.
Formula:C22H25NO4
InChI:InChI=1/C22H25NO4/c1-14(2)11-15(12-21(24)25)23-22(26)27-13-20-18-9-5-3-7-16(18)17-8-4-6-10-19(17)20/h3-10,14-15,20H,11-13H2,1-2H3,(H,23,26)(H,24,25)/t15-/m0/s1
SMILES:CC(C)C[C@@H](CC(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:- Fmoc-beta-Homoleu-OH
- (3S)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-5-methylhexanoic acid
- Fmoc-β-HoLeu-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-β-homoleucine
CAS:Formula:C22H25NO4Purity:>96.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:367.45N-Fmoc-L-β-homoleucine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C22H25NO4Purity:95%Color and Shape:Off-white, PowderMolecular weight:367.45





