CAS 193895-50-0: Notoginsenoside D

Description:Notoginsenoside D is a saponin compound primarily derived from the roots of Panax notoginseng, a plant known for its medicinal properties in traditional Chinese medicine. This compound is characterized by its complex glycosidic structure, which contributes to its biological activity. Notoginsenoside D exhibits various pharmacological effects, including anti-inflammatory, antioxidant, and neuroprotective properties. It has been studied for its potential to enhance blood circulation and promote cardiovascular health. Additionally, Notoginsenoside D may play a role in neuroprotection, potentially benefiting conditions such as neurodegenerative diseases. The compound's mechanism of action often involves modulation of signaling pathways and the regulation of gene expression. As a natural product, Notoginsenoside D is of interest in pharmacognosy and drug development, particularly for its therapeutic potential and relatively low toxicity profile. Its CAS number, 193895-50-0, is used for identification in chemical databases and regulatory contexts. Overall, Notoginsenoside D represents a significant area of research in the field of natural products and their applications in health and medicine.

Formula:C₆₄H₁₀₈O₃₁

InChI:InChI=1S/C64H108O31/c1-25(2)10-9-14-64(8,95-57-51(83)45(77)43(75)33(91-57)24-87-55-50(82)44(76)42(74)32(90-55)23-86-54-48(80)38(70)28(68)21-84-54)26-11-16-63(7)37(26)27(67)18-35-61(5)15-13-36(60(3,4)34(61)12-17-62(35,63)6)92-58-52(46(78)40(72)30(19-65)88-58)94-59-53(47(79)41(73)31(20-66)89-59)93-56-49(81)39(71)29(69)22-85-56/h10,26-59,65-83H,9,11-24H2,1-8H3/t26-,27+,28+,29+,30+,31+,32+,33+,34-,35+,36-,37-,38-,39-,40+,41+,42+,43+,44-,45-,46-,47-,48+,49+,50+,51+,52+,53+,54-,55+,56-,57-,58-,59-,61-,62+,63+,64-/m0/s1

InChI key:InChIKey=UIFSQNKEIFIEJO-SQQCDOLMSA-N

SMILES:OCC1OC(OC2C(O)C(O)C(OC2OC3CCC4(C)C(CCC5(C)C4CC(O)C6C(CCC65C)C(OC7OC(COC8OC(COC9OCC(O)C(O)C9O)C(O)C(O)C8O)C(O)C(O)C7O)(C)CCC=C(C)C)C3(C)C)CO)C(OC%10OCC(O)C(O)C%10O)C(O)C1O

Synonyms:
Notoginsenoside D
(3β,12β)-12-Hydroxy-20-[(O-β-D-xylopyranosyl-(1→6)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl O-β-D-xylopyranosyl-(1→2)-O-β-D-glucopyranosyl-(1→2)-β-D-glucopyranoside
β-D-Glucopyranoside, (3β,12β)-12-hydroxy-20-[(O-β-D-xylopyranosyl-(1→6)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl O-β-D-xylopyranosyl-(1→2)-O-β-D-glucopyranosyl-(1→2)-