CAS 1939-36-2
:PDTA
Description:
PDTA, or 1,2-Propanediamine, N,N,N',N'-tetramethyl-, is a chemical compound characterized by its structure, which includes a central carbon atom bonded to two amine groups and four methyl groups. This compound is often utilized in various applications, including as a chelating agent in coordination chemistry and as a potential ligand in metal complexation. PDTA exhibits properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar solvents. The presence of multiple methyl groups contributes to its steric hindrance, affecting its reactivity and interaction with other molecules. Additionally, PDTA can participate in various chemical reactions, including those involving nucleophilic substitution and coordination with metal ions. Safety considerations should be taken into account when handling PDTA, as with many amines, due to potential irritant properties. Overall, PDTA is a versatile compound with applications in both industrial and research settings.
Formula:C11H18N2O8
InChI:InChI=1S/C11H18N2O8/c14-8(15)4-12(5-9(16)17)2-1-3-13(6-10(18)19)7-11(20)21/h1-7H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21)
InChI key:InChIKey=DMQQXDPCRUGSQB-UHFFFAOYSA-N
SMILES:N(CC(O)=O)(CC(O)=O)CCCN(CC(O)=O)CC(O)=O
Synonyms:- 1,3-Diaminopropane-N,N,N,N-tetraacetic acid
- 1,3-Diaminopropanetetraacetic acid
- 1,3-Pdta
- 1,3-Propanediamine-N,N,N′,N′-tetraacetic acid
- 1,3-Propanediaminetetraacetic acid
- 1,3-Propylenediaminetertaacetic acid
- 2,2',2'',2'''-(Propane-1,2-Diyldinitrilo)Tetraacetic Acid
- 2,2',2'',2'''-(Propane-1,3-Diyldinitrilo)Tetraacetic Acid
- 2-([3-[Bis(carboxymethyl)amino]propyl](carboxymethyl)amino)acetic acid
- Acetic acid, (trimethylenedinitrilo)tetra-
- Chelest PD 4H
- Glycine, N,N′-1,3-propanediylbis[N-(carboxymethyl)-
- N,N′-1,3-Propanediylbis[N-(carboxymethyl)glycine]
- NSC 18484
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,3-Propanediamine-N,N,N',N'-tetraacetic Acid
CAS:Formula:C11H18N2O8Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:306.272,2',2'',2'''-(Propane-1,3-diylbis(azanetriyl))tetraacetic acid
CAS:Formula:C11H18N2O8Purity:97%Color and Shape:SolidMolecular weight:306.26922,2’,2’’,2’’’-(Propane-1,3-Diylbis(Azanetriyl))Tetraacetic Acid
CAS:2,2’,2’’,2’’’-(Propane-1,3-Diylbis(Azanetriyl))Tetraacetic AcidPurity:98%Molecular weight:306.27g/mol2,2′,2”,2”’-(Propane-1,3-diylbis(azanetriyl))tetraacetic acid
CAS:Formula:C11H18N2O8Purity:95.0%Molecular weight:306.2711,3-Diaminopropane-N,N,N²,N²-tetraacetic acid
CAS:<p>1,3-Diaminopropane-N,N,N²,N²-tetraacetic acid (1,3-DAPTA) is a carboxylate that can form chelate complexes with palladium. It is a weak acid that has been shown to have the ability to act as an efficient water scavenger. 1,3-DAPTA is a white crystalline solid with a melting point of 69°C and shows no evidence of kinetic isotope effects. The crystal structure of 1,3-DAPTA consists of two molecules in the asymmetric unit. The nitrogen atoms are coordinated by four oxygen atoms from two neighboring water molecules and one hydrogen atom from the carboxylate group.</p>Formula:C11H18N2O8Purity:Min. 95%Molecular weight:306.27 g/mol




