CAS 19393-83-0
:4-AMINO-6-BROMO-7H-PYRROLO[2,3-D]PYRIMIDINE-5-CARBONITRILE
Description:
4-Amino-6-bromo-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile is a heterocyclic organic compound characterized by its complex bicyclic structure, which incorporates both pyrrole and pyrimidine moieties. The presence of an amino group and a bromine atom contributes to its reactivity and potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The carbonitrile functional group enhances its electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and cycloadditions. This compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its unique structure allows for interactions with biological targets, which is of interest in drug design and development. Additionally, the compound's properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity of the sample. Overall, 4-amino-6-bromo-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile represents a significant compound in the field of organic synthesis and pharmaceutical research.
Formula:C7H4BrN5
InChI:InChI=1/C7H4BrN5/c8-5-3(1-9)4-6(10)11-2-12-7(4)13-5/h2H,(H3,10,11,12,13)
SMILES:C(#N)c1c2c(N)ncnc2[nH]c1Br
Synonyms:- 1H-Pyrrolo[2,3-d]pyrimidine-5-carbonitrile, 4-amino-6-bromo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Amino-6-bromo-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile
CAS:Formula:C7H4BrN5Purity:95%Color and Shape:SolidMolecular weight:238.04424-Amino-6-bromo-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile
CAS:4-Amino-6-bromo-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrilePurity:98%Molecular weight:238.04g/mol4-Amino-6-bromo-5-cyano-7H-pyrrolo[2,3-d]pyrimidine
CAS:4-Amino-6-bromo-5-cyano-7H-pyrrolo[2,3-d]pyrimidine bolongs toIntermediates and Building Blocks - Nucleoside Base; Multi-functional; Heterocyclic Compounds -Formula:C7H4BrN5Color and Shape:SolidMolecular weight:238.04Ref: TM-TNU1015
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire4-Amino-6-bromo-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile
CAS:Purity:98%Molecular weight:238.04800424-Amino-6-bromo-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile
CAS:Controlled ProductFormula:C7H4BrN5Color and Shape:NeatMolecular weight:238.0444-Amino-6-bromo-5-cyano-7H-pyrrol[2,3-d]pyrimidine
CAS:4-Amino-6-bromo-5-cyano-7H-pyrrol[2,3-d]pyrimidine is a synthetic compound that can inhibit the growth of tumor cells by preventing RNA replication. It has been shown to be an efficient method for screening potential antitumor agents. 4AB5C7H is extracted from the tumor cell lines and catalyzed by a variety of enzymes. The debromination process yields high yields of 4AB5C7H, which can be used as a potential inhibitor in cancer therapy.
Purity:Min. 95%





