CAS 19393-94-3

1,3-DIBROMO-4-IODOBENZENE

Description:

1,3-Dibromo-4-iodobenzene is an organic compound characterized by the presence of two bromine atoms and one iodine atom attached to a benzene ring. The compound features a symmetrical substitution pattern, with bromine atoms located at the 1 and 3 positions and iodine at the 4 position of the aromatic ring. This substitution pattern can influence its chemical reactivity and physical properties, such as solubility and melting point. Typically, halogenated aromatic compounds like 1,3-dibromo-4-iodobenzene exhibit significant stability due to the resonance of the benzene ring, but they can also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of multiple halogens can enhance its reactivity, making it useful in organic synthesis and materials science. Additionally, the compound may exhibit interesting electronic properties due to the halogen substituents, which can affect its applications in fields such as pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as halogenated compounds can be hazardous.

Formula: C₆H₃Br₂I

InChI: InChI=1/C6H3Br2I/c7-4-1-2-6(9)5(8)3-4/h1-3H

SMILES: c1cc(c(cc1Br)Br)I

Synonyms:

• 2,4-Dibromo-1-iodobenzene
• Benzene, 2,4-dibromo-1-iodo-

2,4-Dibromo-1-iodobenzene

CAS: 19393-94-3

Formula: C₆H₃Br₂I

Purity: 97%

Color and Shape: Solid

Molecular weight: 361.8005

Ref: IN-DA0037N7

2,4-Dibromoiodobenzene

CAS: 19393-94-3

2,4-Dibromoiodobenzene

Formula: C₆H₃Br₂I

Purity: 98%

Color and Shape: white solid

Molecular weight: 361.80g/mol

Ref: 54-OR471033

2,4-Dibromoiodobenzene

CAS: 19393-94-3

Formula: C₆H₃Br₂I

Purity: 98%

Color and Shape: Solid

Molecular weight: 361.802

Ref: 10-F035714

2,4-Dibromo-1-iodobenzene

Controlled Product

CAS: 19393-94-3

Applications 2,4-dibromo-1-iodobenzene (cas# 19393-94-3) is a useful research chemical.

Formula: C₆H₃Br₂I

Color and Shape: Neat

Molecular weight: 361.8

Ref: TR-B426248