CAS 193944-66-0

4'-AMINO-2,2':6',2'-TERPYRIDINE

Description:

4'-Amino-2,2':6',2'-terpyridine is a heterocyclic organic compound characterized by its unique structure, which consists of a terpyridine backbone with an amino group at the 4' position. This compound features a tricyclic system composed of three pyridine rings connected by two carbon-carbon bonds, which contributes to its aromaticity and stability. The presence of the amino group enhances its potential for hydrogen bonding and increases its solubility in polar solvents. 4'-Amino-2,2':6',2'-terpyridine is known for its applications in coordination chemistry, where it can act as a ligand to form complexes with various metal ions. Its electronic properties, influenced by the amino group and the conjugated system, make it of interest in fields such as materials science and organic electronics. Additionally, the compound may exhibit biological activity, which warrants further investigation for potential pharmaceutical applications. Overall, its structural features and reactivity make it a valuable compound in both academic research and industrial applications.

Formula: C₁₅H₁₂N₄

InChI: InChI=1/C15H12N4/c16-11-9-14(12-5-1-3-7-17-12)19-15(10-11)13-6-2-4-8-18-13/h1-10H,(H2,16,19)

SMILES: c1ccnc(c1)c1cc(cc(c2ccccn2)n1)N

Synonyms:

• [2,2':6',2''-Terpyridin]-4'-Amine

4'-Amino-2,2':6',2''-terpyridine

CAS: 193944-66-0

Formula: C₁₅H₁₂N₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 248.2826

Ref: IN-DA01E73C

4'-Amino-2,2':6',2''-terpyridine

CAS: 193944-66-0

4'-Amino-2,2':6',2''-terpyridine

Purity: 98%

Molecular weight: 248.28g/mol

Ref: 54-OR93478

4'-Amino-2,2':6',2''-terpyridine

CAS: 193944-66-0

4'-Amino-2,2':6',2''-terpyridine is a fine chemical that can be used as a versatile building block in the synthesis of complex compounds. It has been shown to be useful in the synthesis of various research chemicals and reaction components, including pharmaceuticals and agrochemicals. 4'-Amino-2,2':6',2''-terpyridine is also a reagent for organic synthesis and can be used as a high-quality laboratory chemical.

Formula: C₁₅H₁₂N₄

Purity: Min. 80%

Color and Shape: Powder

Molecular weight: 248.28 g/mol

Ref: 3D-FA30901

4′-Amino-2,2′:6′,2”-terpyridine

CAS: 193944-66-0

Purity: 98%

Molecular weight: 248.2890015

Ref: 10-F691084

4'-Amino-2,2':6',2''-terpyridine

CAS: 193944-66-0

4'-Amino-2,2':6',2''-terpyridine is a versatile chemical building block that can be used in the synthesis of complex compounds. It is a high quality reagent and useful intermediate for the production of speciality chemicals. 4'-Amino-2,2':6',2''-terpyridine can also be used as a reaction component or scaffold to produce other compounds. CAS No. 193944-66-0

Formula: C₁₅H₁₂N₄

Purity: Min. 97.0 Area-%

Molecular weight: 248.29 g/mol

Ref: 3D-J-400550