
CAS 193954-28-8
:fmoc-L-beta-homophenylalanine
Description:
Fmoc-L-beta-homophenylalanine is a synthetic amino acid derivative commonly used in peptide synthesis and research. It features a phenylalanine backbone with a beta-homophenylalanine modification, which introduces an additional carbon atom in the side chain, enhancing its structural diversity. The "Fmoc" (9-fluorenylmethoxycarbonyl) group serves as a protective moiety for the amino group, allowing for selective reactions during peptide synthesis while providing stability and solubility. This compound is typically utilized in solid-phase peptide synthesis (SPPS), where the Fmoc group can be easily removed under mild basic conditions, facilitating the sequential addition of amino acids. Its unique structure contributes to the development of peptides with specific properties, making it valuable in drug design and biochemistry. Additionally, Fmoc-L-beta-homophenylalanine can influence the folding and stability of peptides, impacting their biological activity. As with many synthetic amino acids, it is essential to handle this compound with care, following appropriate safety protocols in laboratory settings.
Formula:C25H23NO4
InChI:InChI=1/C25H23NO4/c27-24(28)15-18(14-17-8-2-1-3-9-17)26-25(29)30-16-23-21-12-6-4-10-19(21)20-11-5-7-13-22(20)23/h1-13,18,23H,14-16H2,(H,26,29)(H,27,28)/t18-/m1/s1
SMILES:c1ccc(cc1)C[C@H](CC(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:- Fmoc-beta-Homophe-OH
- (3S)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-phenylbutanoic acid
- (3R)-3-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}-4-phenylbutanoic acid
- Fmoc-β-HoPhe-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Fmoc-L-β-homophenylalanine, 95%
CAS:N-Fmoc-L-beta-homophenylalanine is used for producing high quality peptides. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code orFormula:C25H23NO4Purity:95%Molecular weight:401.46(S)-3-[[[(9H-Fluoren-9-yl)methoxy]carbonyl]amino]-4-phenylbutanoic acid
CAS:Formula:C25H23NO4Purity:96%Color and Shape:SolidMolecular weight:401.4544Fmoc-ß-HoPhe-OH
CAS:M06114 - Fmoc-ß-HoPhe-OH
Formula:C25H23NO4Purity:97%Color and Shape:Solid, Off-white powderMolecular weight:401.462




