CAS 193978-23-3
:2-Thiopheneboronic acid pinacol ester
Description:
2-Thiopheneboronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid functional group and a thiophene ring. This compound typically exhibits a white to off-white solid appearance and is soluble in organic solvents such as dichloromethane and ethanol. The pinacol ester formation enhances the stability of the boronic acid moiety, making it less reactive compared to its free acid form. This compound is often utilized in organic synthesis, particularly in cross-coupling reactions, such as Suzuki-Miyaura coupling, due to its ability to form carbon-boron bonds. Additionally, the thiophene ring contributes to the compound's electronic properties, making it useful in the development of organic semiconductors and materials for electronic applications. The presence of the boron atom allows for potential applications in medicinal chemistry, particularly in drug design and development, as boron-containing compounds can interact with biological systems in unique ways. Overall, 2-Thiopheneboronic acid pinacol ester is a versatile compound with significant utility in various fields of chemistry.
Formula:C10H15BO2S
InChI:InChI=1/C10H15BO2S/c1-9(2)10(3,4)13-11(12-9)8-6-5-7-14-8/h5-7H,1-4H3
SMILES:CC1(C)C(C)(C)OB(c2cccs2)O1
Synonyms:- Thiophene-2-boronic acid pinacol ester
- 4,4,5,5-Tetramethyl-2-Thiophen-2-Yl-1,3,2-Dioxaborolane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)thiophene
CAS:Formula:C10H15BO2SPurity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:210.10Thiophene-2-boronic acid pinacol ester, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H15BO2SPurity:98%Color and Shape:White to pale cream, Powder or crystals or crystalline powderMolecular weight:210.10Thiophene-2-boronic acid, pinacol ester
CAS:Formula:C10H15BO2SPurity:97%Color and Shape:SolidMolecular weight:210.1009Thiophene-2-boronic acid, pinacol ester
CAS:Thiophene-2-boronic acid, pinacol esterFormula:C10H15BO2SPurity:98%Color and Shape: off-white solidMolecular weight:210.10g/mol2-(Thiopheneboronic acid)pinacol ester
CAS:Formula:C10H15BO2SPurity:97%Color and Shape:SolidMolecular weight:210.1




