
CAS 19398-78-8
:3,4-Diethyl-3-hexanol
Description:
3,4-Diethyl-3-hexanol is an organic compound classified as a secondary alcohol due to the presence of a hydroxyl (-OH) group attached to a carbon atom that is bonded to two other carbon atoms. Its molecular structure features a six-carbon chain with two ethyl groups attached to the third carbon, contributing to its unique properties. This compound is typically a colorless liquid at room temperature and exhibits a moderate boiling point, characteristic of alcohols. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic ethyl groups. 3,4-Diethyl-3-hexanol may be used in various applications, including as a solvent or in the synthesis of other chemical compounds. Its chemical behavior is influenced by the presence of the hydroxyl group, which can participate in hydrogen bonding, affecting its reactivity and interactions with other substances. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C10H22O
InChI:InChI=1S/C10H22O/c1-5-9(6-2)10(11,7-3)8-4/h9,11H,5-8H2,1-4H3
InChI key:InChIKey=WKHFIEUDEJOTPQ-UHFFFAOYSA-N
SMILES:C(C(CC)CC)(CC)(CC)O
Synonyms:- 3,4-Diethyl-3-hexanol
- 3-Hexanol, 3,4-diethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3,4-Diethyl-3-hexanol
CAS:<p>3,4-Diethyl-3-hexanol is a chemical compound that is used as an ophthalmic agent. It is a colorless or white solid. 3,4-Diethyl-3-hexanol has been shown to be an antiviral agent that blocks the virus from entering the cells of the body. It also prevents the virus from replicating its genetic material and spreading throughout the body. This drug can be used in infants, pregnant women, and adults. 3,4-Diethyl-3-hexanol binds to plasma proteins and may interfere with levothyroxine metabolism in some cases. It has been shown to have no adverse effects on dihedral angles or boceprevir activity and has low toxicity levels in rats.</p>Formula:C10H22OPurity:Min. 95%Molecular weight:158.28 g/mol

