CAS 1940-31-4

N-(2-Bromo-4,5-dichlorophenyl)acetamide

Description:

N-(2-Bromo-4,5-dichlorophenyl)acetamide, with the CAS number 1940-31-4, is a chemical compound characterized by its acetamide functional group attached to a phenyl ring that is substituted with bromine and chlorine atoms. This compound typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of halogen substituents, specifically bromine and chlorine, can influence the compound's reactivity, solubility, and biological activity. The molecular structure suggests that it may exhibit specific interactions with biological targets, making it of interest in drug design. Additionally, the compound's stability and reactivity can be affected by the electronic effects of the halogens, which can alter its chemical behavior in various environments. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks. Overall, N-(2-Bromo-4,5-dichlorophenyl)acetamide is a notable compound in the realm of organic chemistry and pharmacology.

Formula: C₈H₆BrCl₂NO

InChI: InChI=1S/C8H6BrCl2NO/c1-4(13)12-8-3-7(11)6(10)2-5(8)9/h2-3H,1H3,(H,12,13)

InChI key: InChIKey=VIWRGBIBHKQAPZ-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1=C(Br)C=C(Cl)C(Cl)=C1

Synonyms:

• Acetanilide, 2′-bromo-4′,5′-dichloro-
• N-(2-Bromo-4,5-dichlorophenyl)acetamide
• Acetamide, N-(2-bromo-4,5-dichlorophenyl)-

N-Acetyl 2-bromo-4,5-dichloroaniline

CAS: 1940-31-4

Formula: C₈H₆BrCl₂NO

Color and Shape: Solid

Molecular weight: 282.9493

Ref: IN-DA0074PW

N-(2-Bromo-4,5-dichlorophenyl)acetamide

CAS: 1940-31-4

Formula: C₈H₆BrCl₂NO

Purity: 95.0%

Molecular weight: 282.95

Ref: 10-F212772