CAS 19405-50-6: adrenocorticotropic hormone fragment*1-4 human
Description:Adrenocorticotropic hormone fragment 1-4 (ACTH 1-4) is a peptide derived from the larger adrenocorticotropic hormone, which plays a crucial role in the regulation of cortisol production from the adrenal glands. The fragment consists of the first four amino acids of the ACTH sequence, which are critical for its biological activity. This peptide is involved in various physiological processes, including stress response and metabolism regulation. Its structure typically includes a sequence of amino acids that contribute to its binding affinity to specific receptors, influencing adrenal function. The CAS number 19405-50-6 uniquely identifies this compound in chemical databases, facilitating research and application in pharmacology and biochemistry. ACTH 1-4 is often studied for its potential therapeutic effects and its role in understanding the mechanisms of adrenal disorders. As a fragment, it may exhibit different properties compared to the full-length hormone, including altered receptor interactions and biological activity, making it a subject of interest in both clinical and experimental settings.
Formula:C20H30N4O8S
InChI:InChI=1/C20H30N4O8S/c1-33-7-6-14(20(31)32)22-19(30)16(10-26)24-18(29)15(23-17(28)13(21)9-25)8-11-2-4-12(27)5-3-11/h2-5,13-16,25-27H,6-10,21H2,1H3,(H,22,30)(H,23,28)(H,24,29)(H,31,32)/t13-,14-,15-,16-/m0/s1
- Synonyms:
- Acth (1-4)
- H-Ser-Tyr-Ser-Met-OH
- beta-[(2R)-2-amino-3-hydroxypropanoyl]-L-tyrosyl-L-seryl-L-methionine
- L-seryl-L-tyrosyl-L-seryl-L-methionine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Acth (1-4) REF: TM-T20482CAS: 19405-50-6 | 98% | To inquire | Mon 05 May 25 |
![]() | ACTH (1-4) REF: 3D-FA73153CAS: 19405-50-6 | Min. 95% | - - - | Discontinued product |

Acth (1-4)
Ref: TM-T20482
100mg | To inquire | ||
500mg | To inquire |

ACTH (1-4)
Ref: 3D-FA73153
1mg | Discontinued | Request information | |
2mg | Discontinued | Request information | |
5mg | Discontinued | Request information | |
250µg | Discontinued | Request information | |
500µg | Discontinued | Request information |