CAS 194089-07-1

1-[2-(4-CHLOROPHENYL)ETHYL]-1,2,3,4-TETRAHYDRO-6-METHOXY-2-METHYL-7-ISOQUINOLINOL HYDROCHLORIDE

Description:

1-[2-(4-Chlorophenyl)ethyl]-1,2,3,4-tetrahydro-6-methoxy-2-methyl-7-isoquinolinol hydrochloride is a chemical compound characterized by its complex isoquinoline structure, which includes a tetrahydroisoquinoline core. This compound features a 4-chlorophenyl group and a methoxy group, contributing to its unique pharmacological properties. It is typically a white to off-white solid, soluble in polar solvents such as water and methanol, which is common for hydrochloride salts. The presence of the hydrochloride moiety enhances its solubility and stability. This compound may exhibit biological activity, potentially influencing neurotransmitter systems, making it of interest in medicinal chemistry and pharmacology. Its specific interactions and effects would depend on its molecular structure and the presence of functional groups, which can influence binding affinity and selectivity for various biological targets. As with many chemical substances, safety data and handling precautions should be observed, particularly due to the presence of the chlorophenyl group, which may pose environmental and health risks.

Formula: C₁₉H₂₃Cl₂NO₂

InChI: InChI=1/C19H22ClNO2.ClH/c1-21-10-9-14-11-19(23-2)18(22)12-16(14)17(21)8-5-13-3-6-15(20)7-4-13;/h3-4,6-7,11-12,17,22H,5,8-10H2,1-2H3;1H

SMILES: CN1CCc2cc(c(cc2C1CCc1ccc(cc1)Cl)O)OC.Cl

Synonyms:

• Ro 04-5595 Hydrochloride
• 1-[2-(4-Chlorophenyl)Ethyl]-7-Hydroxy-6-Methoxy-2-Methyl-1,2,3,4-Tetrahydroisoquinolinium Chloride

Ro 04-5595

Controlled Product

CAS: 194089-07-1

Formula: C₁₉H₂₂ClNO₂

Color and Shape: Neat

Molecular weight: 331.837

Ref: TR-R700893

Ro 04-5595 free base

CAS: 194089-07-1

"Ro 04-5595: Selective NMDA NR2B antagonist, EC50 186nmol/L; binds EVT-101 site; hierarchy of inhibition affinity observed."

Formula: C₁₉H₂₂ClNO₂

Color and Shape: Solid

Molecular weight: 331.84

Ref: TM-T70049