CAS 1941-52-2
:D-Glucose, diethyl dithioacetal
Description:
D-Glucose, diethyl dithioacetal, is a chemical compound characterized by its structure, which includes a glucose moiety modified with diethyl dithioacetal groups. This modification enhances its stability and solubility in organic solvents, making it useful in various chemical applications, particularly in organic synthesis and carbohydrate chemistry. The presence of dithioacetal groups allows for the protection of the aldehyde functional group of glucose, facilitating further chemical transformations without the risk of oxidation. This compound typically appears as a colorless to pale yellow liquid and has a relatively low volatility. Its reactivity is influenced by the dithioacetal groups, which can undergo cleavage under specific conditions, releasing the original glucose structure. D-Glucose, diethyl dithioacetal is often utilized in the synthesis of glycosides and other derivatives, serving as a versatile intermediate in the preparation of more complex carbohydrate-based compounds. As with many organosulfur compounds, it should be handled with care due to potential toxicity and reactivity.
Formula:C10H22O5S2
InChI:InChI=1S/C10H22O5S2/c1-3-16-10(17-4-2)9(15)8(14)7(13)6(12)5-11/h6-15H,3-5H2,1-2H3/t6-,7-,8+,9-/m1/s1
InChI key:InChIKey=BTOYCPDACQXQRS-LURQLKTLSA-N
SMILES:C([C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O)(SCC)SCC
Synonyms:- (2R,3R,4R,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol (non-preferred name)
- (2R,3R,4R,5S)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol (non-preferred name)
- (2R,3R,4S,5R)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol (non-preferred name)
- (2R,3R,4S,5S)-6,6-bis(ethylsulfanyl)hexane-1,2,3,4,5-pentol (non-preferred name)
- 6,6-Bis(Ethylsulfanyl)Hexane-1,2,3,4,5-Pentol (Non-Preferred Name)
- <span class="text-smallcaps">D</span>-Glucose, diethyl dithioacetal
- <span class="text-smallcaps">D</span>-Glucose, diethyl mercaptal
- Glucose diethyl mercaptal
- NSC 19773
- NSC 8521
- D-glucose diethyl mercaptal
- D-(-)-Glucose diethyl mercaptal
- D-Glucose, diethyl mercaptal
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
D-Glucose Diethyl Mercaptal
CAS:Formula:C10H22O5S2Purity:98%Color and Shape:SolidMolecular weight:286.4087(2R,3R,4S,5R)-6,6-Bis(Ethylthio)Hexane-1,2,3,4,5-Pentaol
CAS:(2R,3R,4S,5R)-6,6-Bis(Ethylthio)Hexane-1,2,3,4,5-PentaolPurity:>98.0%Molecular weight:286.41g/molD-Glucose Diethyl Mercaptal
CAS:Formula:C10H22O5S2Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:286.40D-Glucose diethyl mercaptal
CAS:D-Glucose diethyl mercaptal is a homogeneous catalyst that can be used to acetylate galactitol to produce D-arabinose. It acts as an efficient and selective catalyst for the reaction of nitrous acid with hydrochloric acid, which produces acetyl chloride. Acetyl chloride is a reactive compound that can be used in the synthesis of many other compounds. D-Glucose diethyl mercaptal has been used in chromatographic methods to separate d-arabinose from L-arabinose. The ring-opening polymerization of D-glucopyranose by mercaptals leads to the formation of polyols, which are useful materials for the production of plastics and rubber products. Chloride ions are required for this reaction, while hydrogen chloride is produced as a byproduct.Formula:C10H22O5S2Purity:Min. 95%Molecular weight:286.41 g/mol





