CymitQuimica logo

CAS 194146-02-6

:

4-(4-iodophenyl)-4-oxobutanoic acid

Description:
4-(4-Iodophenyl)-4-oxobutanoic acid, with the CAS number 194146-02-6, is an organic compound characterized by its functional groups and structural features. It contains a butanoic acid backbone with a ketone group at the fourth position and a para-iodophenyl substituent at the same carbon. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. The iodine atom in the para position can influence the compound's reactivity and stability, potentially enhancing its electrophilic character. Additionally, the presence of the aromatic ring contributes to its overall stability and may affect its interaction with biological systems. The compound may be of interest in medicinal chemistry and material science due to its unique structural properties, which could facilitate various chemical reactions or biological activities. As with many organic compounds, safety precautions should be observed when handling this substance, considering potential hazards associated with iodine and organic acids.
Formula:C10H9IO3
InChI:InChI=1/C10H9IO3/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14/h1-4H,5-6H2,(H,13,14)
InChI key:KWWZSFSPTHZIBN-UHFFFAOYSA-N
SMILES:c1cc(ccc1C(=O)CCC(=O)O)I
Synonyms:
  • 4-(4-Iodo-phenyl)-4-oxo-butyric acid
Found 4 products.