CAS 19415-40-8
:2-(CHLOROMETHYL)-4-FLUORO-1-METHOXYBENZENE
Description:
2-(Chloromethyl)-4-fluoro-1-methoxybenzene, with the CAS number 19415-40-8, is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3), a fluorine atom, and a chloromethyl group (-CH2Cl) attached to a benzene ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the presence of the chloromethyl group, which can participate in nucleophilic substitution reactions. The fluorine atom contributes to the compound's lipophilicity and can influence its biological activity and chemical stability. Additionally, the methoxy group can affect the electronic properties of the aromatic ring, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Safety precautions should be taken when handling this compound, as it may pose health risks due to its chlorinated and fluorinated components. Proper storage and disposal methods are essential to mitigate environmental impact and ensure safety.
Formula:C8H8ClFO
InChI:InChI=1/C8H8ClFO/c1-11-8-3-2-7(10)4-6(8)5-9/h2-4H,5H2,1H3
SMILES:COc1ccc(cc1CCl)F
Synonyms:- 2-(Chloromethyl)-4-fluorophenyl methyl ether
- Benzene, 2-(Chloromethyl)-4-Fluoro-1-Methoxy-
- 2-(Chloromethyl)-4-fluoro-1-methoxybenzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
