CAS 19416-87-6
:5,7-dihydroxy-6-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)ox an-2-yl]-2-[4-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan -2-yl]oxyphenyl]chromen-4-one
Description:
The chemical substance known as "5,7-dihydroxy-6-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-2-[4-[(2S,3S,4R,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromen-4-one," with the CAS number 19416-87-6, is a flavonoid compound characterized by its complex polyphenolic structure. It features multiple hydroxyl groups, contributing to its potential antioxidant properties. The presence of sugar moieties indicates that it may exhibit glycosidic characteristics, which can influence its solubility and bioavailability. This compound is often studied for its biological activities, including anti-inflammatory and anticancer effects, due to its ability to modulate various cellular pathways. Its structural configuration, particularly the stereochemistry of the sugar units, plays a crucial role in its interaction with biological targets. Overall, this compound exemplifies the intricate relationship between chemical structure and biological function, making it a subject of interest in pharmacological research and natural product chemistry.
Formula:C27H30O15
InChI:InChI=1/C27H30O15/c28-7-15-19(32)22(35)24(37)26(41-15)18-12(31)6-14-17(21(18)34)11(30)5-13(40-14)9-1-3-10(4-2-9)39-27-25(38)23(36)20(33)16(8-29)42-27/h1-6,15-16,19-20,22-29,31-38H,7-8H2/t15-,16-,19-,20-,22+,23+,24-,25-,26+,27-/m1/s1
Synonyms:- 4H-1-Benzopyran-4-one, 6-beta-D-glucopyranosyl-2-(4-(beta-D-glucopyranosyloxy)phenyl)-5,7-dihydroxy-
- (1S)-1,5-anhydro-1-{2-[4-(beta-D-glucopyranosyloxy)phenyl]-5,7-dihydroxy-4-oxo-4H-chromen-6-yl}-D-glucitol
- Isosaponarin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Isosaponarin
CAS:Formula:C27H30O15Purity:95%~99%Color and Shape:Yellow powderMolecular weight:594.522Isosaponarin
CAS:<p>Isosaponarin inhibits the increase in Ca2+ levels, thereby inhibiting the release of glutamate from vesicles in synaptosomes.</p>Formula:C27H30O15Purity:99.12%Color and Shape:SolidMolecular weight:594.52Isosaponarin
CAS:<p>Isosaponarin is a flavonoid glycoside, which is a naturally occurring compound primarily found in the plant Gentiana olivieri. This compound is known for its distinctive antioxidant and anti-inflammatory properties attributed to its molecular structure, which includes an isovitexin core linked to a sugar moiety. Isosaponarin exerts its effects by scavenging free radicals and modulating various biochemical pathways involved in inflammation and oxidative stress. This mode of action makes it a compound of interest in the study of cellular protection and potential therapeutic applications.</p>Formula:C27H30O15Purity:Min. 95%Molecular weight:594.5 g/mol



