CAS 1943-97-1
:4,4′-(Octahydro-4,7-methano-5H-inden-5-ylidene)bis[phenol]
Description:
4,4′-(Octahydro-4,7-methano-5H-inden-5-ylidene)bis[phenol], commonly referred to as a bisphenol compound, is characterized by its unique molecular structure that includes two phenolic groups linked by an octahydro-4,7-methano-5H-inden-5-ylidene moiety. This compound typically exhibits properties such as high thermal stability and resistance to chemical degradation, making it suitable for various applications in polymer chemistry and materials science. It is often utilized in the synthesis of polycarbonate and epoxy resins, contributing to the production of durable and heat-resistant materials. The presence of multiple hydroxyl groups in its structure enhances its reactivity, allowing for further functionalization and cross-linking in polymer matrices. Additionally, its hydrophobic characteristics can influence solubility and compatibility with other organic compounds. Safety data sheets indicate that, like many phenolic compounds, it should be handled with care due to potential health hazards associated with exposure. Overall, this compound plays a significant role in the development of advanced materials with desirable mechanical and thermal properties.
Formula:C22H24O2
InChI:InChI=1S/C22H24O2/c23-17-8-4-15(5-9-17)22(16-6-10-18(24)11-7-16)13-14-12-21(22)20-3-1-2-19(14)20/h4-11,14,19-21,23-24H,1-3,12-13H2
InChI key:InChIKey=WWCSTJWKTAXUGJ-UHFFFAOYSA-N
SMILES:OC1=CC=C(C2(C3C4C(C(C2)C3)CCC4)C5=CC=C(O)C=C5)C=C1
Synonyms:- 4,4′-(Hexahydro-4,7-methyleneindan-5-ylidene)diphenol
- 4,4′-(Octahydro-4,7-methano-5H-inden-5-ylidene)bis[phenol]
- 4,4′-(Hexahydro-4,7-methanoindan-5-ylidene)diphenol
- Phenol, 4,4′-(octahydro-4,7-methano-5H-inden-5-ylidene)bis-
- Phenol, 4,4′-(tetrahydro-4,7-methanoindan-5(4H)-ylidene)di-
- Phenol, 4,4'-(octahydro-4,7-methano-5H-inden-5-ylidene)bis-
- 4,4'-octahydro-1H-4,7-methanoindene-5,5-diyldiphenol
- 4,4'-(3aS,4S,7R,7aR)-octahydro-1H-4,7-methanoindene-5,5-diyldiphenol
- p,p'-(Octahydro-4,7-methano-5H-inden-5-ylidene)bisphenol
- 4,4'-(3aS,4R,7S,7aR)-octahydro-1H-4,7-methanoindene-5,5-diyldiphenol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
