CAS 19431-21-1
:lys-lys-lys-lys-lys
Description:
The chemical substance known as "lys-lys-lys-lys-lys," with the CAS number 19431-21-1, is a pentapeptide composed of five lysine (Lys) amino acid residues linked together by peptide bonds. Lysine is a basic amino acid characterized by its positively charged side chain at physiological pH, which contributes to its role in protein structure and function. This pentapeptide exhibits properties typical of polycationic peptides, including high solubility in water and potential interactions with negatively charged molecules, such as nucleic acids and membranes. Due to its multiple lysine residues, it may also have implications in biological processes, such as cell signaling and gene expression regulation. Additionally, the presence of multiple amino groups can enhance its reactivity and potential for modification, making it of interest in various biochemical and pharmaceutical applications. Overall, lys-lys-lys-lys-lys serves as a model for studying peptide behavior and interactions in biological systems.
Formula:C30H62N10O6
InChI:InChI=1/C30H62N10O6/c31-15-5-1-9-21(36)26(41)20(19-35)13-14-22(37)27(42)38-23(10-2-6-16-32)28(43)39-24(11-3-7-17-33)29(44)40-25(30(45)46)12-4-8-18-34/h20-25H,1-19,31-37H2,(H,38,42)(H,39,43)(H,40,44)(H,45,46)/t20?,21-,22-,23-,24-,25-/m0/s1
SMILES:C(CCN)C[C@@H](C(=O)C(CC[C@@H](C(=N[C@@H](CCCCN)C(=N[C@@H](CCCCN)C(=N[C@@H](CCCCN)C(=O)O)O)O)O)N)CN)N
Synonyms:- Pentalysine
- Lysyl-lysyl-lysyl-lysyl-lysyl
- L-Lysine, N2-(N2-(N2-(N2-L-lysyl-L-lysyl)-L-lysyl)-L-lysyl)-
- 5-[(2S)-2,6-diaminohexanoyl]-L-lysyl-L-lysyl-L-lysyl-L-lysine
- Lys-lys-lys-lys-lys
- L-Lysine,L-lysyl-L-lysyl-L-lysyl-L-lysyl-
- Lys-Lys-Lys-Lys-Lys >=55% peptide basis
- L-Lysyl-L-lysyl-L-lysyl-L-lysyl-L-lysine
- 5-mer polyLys PO00002137-02
- Lys5
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Pentalysine
CAS:Pentalysine is a peptide.Formula:C30H62N10O6Color and Shape:SolidMolecular weight:658.88H-Lys-Lys-Lys-Lys-Lys-OH
CAS:Custom research peptide; min purity 95%. For different specs please use the Peptide Quote Tool
Formula:C30H62N10O6Molecular weight:658.89 g/molL-Lysyl-L-lysyl-L-lysyl-L-lysyl-L-lysine
CAS:L-Lysyl-L-lysyl-L-lysyl-L-lysyl-L-lysine (LLLLLL) is an antibacterial agent that belongs to the class of pharmacological agents. LLLLLL has been shown to have antibacterial efficacy against oral pathogens, such as Streptococcus mutans and Porphyromonas gingivalis. LLLLLL binds to the bacterial cell wall by forming a covalent disulfide bond with cysteine residues on the peptidoglycan layer. This prevents cell wall synthesis, leading to cell death by inhibiting protein synthesis. LLLLLL has also been shown to have low toxicity in animal models for long periods of time, with high values in human serum.Formula:C30H62N10O6Purity:Min. 95%Molecular weight:658.88 g/molH-Lys-Lys-Lys-Lys-Lys-OH
CAS:Pentalysine. KKKKK corresponds to the N-terminal sequence of the MARCKS peptide.Formula:C30H62N10O6Purity:99.0%Color and Shape:White PowderMolecular weight:658.89


