CAS 19434-42-5

5-Amino-(1,1'-biphenyl)-2-ol

Description:

5-Amino-(1,1'-biphenyl)-2-ol, with the CAS number 19434-42-5, is an organic compound characterized by the presence of an amino group and a hydroxyl group attached to a biphenyl structure. This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic nature. The amino group (-NH2) contributes to its basicity and potential reactivity, while the hydroxyl group (-OH) can participate in hydrogen bonding, influencing its solubility and reactivity in various chemical environments. The biphenyl backbone provides stability and contributes to the compound's electronic properties, making it of interest in various applications, including organic synthesis and potentially in the development of dyes or pharmaceuticals. Its chemical behavior can be influenced by the presence of substituents on the biphenyl rings, which can modulate its reactivity and interaction with other molecules. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula: C₁₂H₁₁NO

InChI: InChI=1/C12H11NO/c13-10-6-7-12(14)11(8-10)9-4-2-1-3-5-9/h1-8,14H,13H2

SMILES: c1ccc(cc1)c1cc(ccc1O)N

Synonyms:

• 4-Amino-2-Phenylphenol
• 5-Aminobiphenyl-2-Ol

[1,1'-Biphenyl]-2-ol,5-amino-

CAS: 19434-42-5

Formula: C₁₂H₁₁NO

Purity: 96%

Color and Shape: Solid

Molecular weight: 185.2218

Ref: IN-DA007RNX

4-Amino-2-phenylphenol

CAS: 19434-42-5

4-Amino-2-phenylphenol

Purity: 96%

Molecular weight: 185.22g/mol

Ref: 54-OR93211

Carvedilol Impurity 24

CAS: 19434-42-5

Formula: C₁₂H₁₁NO

Molecular weight: 185.23

Ref: 4Z-C-0268

4-Amino-2-phenylphenol

CAS: 19434-42-5

Versatile small molecule scaffold

Formula: C₁₂H₁₁NO

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 185.22 g/mol

Ref: 3D-UAA43442

4-Amino-2-phenylphenol

CAS: 19434-42-5

Purity: 96%

Molecular weight: 185.2259979

Ref: 10-F649472