CymitQuimica logo

CAS 194413-43-9

:

rel-5-Methyl-3-[(11R)-2,6,11-trihydroxy-11-[(2R,2′R,5R,5′R)-octahydro-5′-[(1R)-1-hydroxyundecyl][2,2′-bifuran]-5-yl]undecyl]-2(5H)-furanone

Description:
Rel-5-Methyl-3-[(11R)-2,6,11-trihydroxy-11-[(2R,2′R,5R,5′R)-octahydro-5′-[(1R)-1-hydroxyundecyl][2,2′-bifuran]-5-yl]undecyl]-2(5H)-furanone, with CAS number 194413-43-9, is a complex organic compound characterized by its intricate molecular structure, which includes multiple hydroxyl groups and a furanone ring. This compound features a chiral center, indicating that it exists in multiple stereoisomeric forms, which can influence its biological activity and interactions. The presence of long hydrocarbon chains and multiple functional groups suggests potential applications in pharmaceuticals or as a biochemical agent. Its solubility, stability, and reactivity would depend on the specific functional groups and the overall molecular conformation. Additionally, the compound's synthesis and characterization would require advanced techniques in organic chemistry, including spectroscopic methods for structural elucidation. Understanding its properties and behavior in various environments is crucial for potential applications in medicinal chemistry or materials science.
Formula:C35H62O8
InChI:InChI=1S/C35H62O8/c1-3-4-5-6-7-8-9-10-17-29(38)31-19-21-33(42-31)34-22-20-32(43-34)30(39)18-12-11-14-27(36)15-13-16-28(37)24-26-23-25(2)41-35(26)40/h23,25,27-34,36-39H,3-22,24H2,1-2H3/t25?,27?,28?,29-,30-,31-,32-,33-,34-/m1/s1
InChI key:InChIKey=ZZFFUICBXFIPAB-DSHRFHBESA-N
SMILES:[C@H](CCCCC(CCCC(CC1=CC(C)OC1=O)O)O)(O)[C@@]2(O[C@](CC2)([C@@]3(O[C@@]([C@@H](CCCCCCCCCC)O)(CC3)[H])[H])[H])[H]
Synonyms:
  • Annonisin
  • rel-5-Methyl-3-[(11R)-2,6,11-trihydroxy-11-[(2R,2′R,5R,5′R)-octahydro-5′-[(1R)-1-hydroxyundecyl][2,2′-bifuran]-5-yl]undecyl]-2(5H)-furanone
  • 2(5H)-Furanone, 5-methyl-3-[(11R)-2,6,11-trihydroxy-11-[(2R,2′R,5R,5′R)-octahydro-5′-[(1R)-1-hydroxyundecyl][2,2′-bifuran]-5-yl]undecyl]-, rel-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.