CAS 194421-56-2

(1R,5S)-6,6-diMethyl-3-azabicyclo[3.1.0]hexane-2,4-dione

Description:

(1R,5S)-6,6-Dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione, with the CAS number 194421-56-2, is a bicyclic compound featuring a nitrogen atom within its ring structure. This compound is characterized by its unique bicyclic framework, which consists of a six-membered ring containing a nitrogen atom and two carbonyl groups (diones) at specific positions. The presence of two methyl groups at the 6-position contributes to its steric properties and may influence its reactivity and interactions with other molecules. The specific stereochemistry, indicated by the (1R,5S) configuration, suggests that the compound has distinct spatial arrangements that can affect its biological activity and chemical behavior. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the azabicyclic structure can provide a scaffold for further chemical modifications, potentially leading to derivatives with enhanced or altered properties. Overall, this compound exemplifies the complexity and diversity of organic molecules in the field of chemistry.

InChI: InChI=1S/C7H9NO2/c1-7(2)3-4(7)6(10)8-5(3)9/h3-4H,1-2H3,(H,8,9,10)

SMILES: CC1(C)C2C1C(=O)N=C2O

Synonyms:

• 6,6-Dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione

3-Azabicyclo[3.1.0]hexane-2,4-dione, 6,6-dimethyl-

CAS: 194421-56-2

Formula: C₇H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 139.1519

Ref: IN-DA00I326

6,6-Dimethyl-3-Azabicyclo[3.1.0]hexane-2,4-dione

CAS: 194421-56-2

6,6-Dimethyl-3-Azabicyclo[3.1.0]hexane-2,4-dione

Purity: 98%

Molecular weight: 139.15g/mol

Ref: 54-OR95727

6,6-Dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione

CAS: 194421-56-2

Formula: C₇H₉NO₂

Purity: 97%

Molecular weight: 139.154

Ref: 10-F228867