CAS 194423-15-9

PD 168393

Description:

PD 168393, with the CAS number 194423-15-9, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its role as a selective inhibitor of certain protein kinases. This compound is characterized by its ability to modulate specific signaling pathways, making it a subject of interest in cancer research and other therapeutic areas. PD 168393 is known for its high potency and selectivity, which are crucial for minimizing off-target effects in biological systems. The compound typically exhibits good solubility in organic solvents, which facilitates its use in various experimental settings. Additionally, its molecular structure includes functional groups that contribute to its biological activity and pharmacokinetic properties. As with many compounds in drug development, understanding its mechanism of action, efficacy, and safety profile is essential for potential therapeutic applications. Overall, PD 168393 represents a significant advancement in the search for targeted therapies in oncology and related fields.

Formula: C₁₇H₁₃BrN₄O

InChI: InChI=1S/C17H13BrN4O/c1-2-16(23)21-13-6-7-15-14(9-13)17(20-10-19-15)22-12-5-3-4-11(18)8-12/h2-10H,1H2,(H,21,23)(H,19,20,22)

InChI key: InChIKey=HTUBKQUPEREOGA-UHFFFAOYSA-N

SMILES: N(C=1C2=C(C=CC(NC(C=C)=O)=C2)N=CN1)C3=CC(Br)=CC=C3

Synonyms:

• N-[4-[(3-Bromophenyl)amino]-6-quinazolinyl]-2-propenamide
• Pd 168393
• 2-Propenamide, N-[4-[(3-bromophenyl)amino]-6-quinazolinyl]-

4-[(3-BROMOPHENYL)AMINO]-6-ACRYLAMIDOQUINAZOLINE

CAS: 194423-15-9

Formula: C₁₇H₁₃BrN₄O

Purity: %

Color and Shape: Solid

Molecular weight: 369.2153

Ref: IN-DA00AOT8

PD168393

CAS: 194423-15-9

PD168393

Purity: ≥98%

Molecular weight: 369.22g/mol

Ref: 54-BUP07660

N-(4-((3-Bromophenyl)Amino)Quinazolin-6-yl)Acrylamide

CAS: 194423-15-9

N-(4-((3-Bromophenyl)Amino)Quinazolin-6-yl)Acrylamide

Purity: 99%

Molecular weight: 369.22g/mol

Ref: 54-OR1025441

PD168393

CAS: 194423-15-9

PD168393 is an irreversible EGFR inhibitor (IC50: 0.70 nM), irreversibly alkylate Cys-773; inactive against PKC, FGFR, PDGFR, and insulin.

Formula: C₁₇H₁₃BrN₄O

Purity: 99.13% - 99.83%

Color and Shape: Solid

Molecular weight: 369.22

Ref: TM-T6932

4-[(3-BROMOPHENYL)AMINO]-6-ACRYLAMIDOQUINAZOLINE

CAS: 194423-15-9

Purity: 95.0%

Molecular weight: 369.22198486328125

Ref: 10-F527819

PD 168393

CAS: 194423-15-9

PD 168393 is a potent and selective irreversible inhibitor of the epidermal growth factor receptor (EGFR) tyrosine kinase. It is synthesized through advanced chemical processes, designed to specifically target and covalently modify the ATP-binding site of EGFR. The mode of action involves the irreversible binding to the cysteine residue in the ATP-binding pocket, leading to the inhibition of EGFR autophosphorylation and subsequent downstream signaling pathways.

Formula: C₁₇H₁₃BrN₄O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 369.22 g/mol

Ref: 3D-UHA42315