CAS 194423-15-9: PD 168393
Description:PD 168393, with the CAS number 194423-15-9, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its role as a selective inhibitor of certain protein kinases. This compound is characterized by its ability to modulate specific signaling pathways, making it a subject of interest in cancer research and other therapeutic areas. PD 168393 is known for its high potency and selectivity, which are crucial for minimizing off-target effects in biological systems. The compound typically exhibits good solubility in organic solvents, which facilitates its use in various experimental settings. Additionally, its molecular structure includes functional groups that contribute to its biological activity and pharmacokinetic properties. As with many compounds in drug development, understanding its mechanism of action, efficacy, and safety profile is essential for potential therapeutic applications. Overall, PD 168393 represents a significant advancement in the search for targeted therapies in oncology and related fields.
Formula:C17H13BrN4O
InChI:InChI=1S/C17H13BrN4O/c1-2-16(23)21-13-6-7-15-14(9-13)17(20-10-19-15)22-12-5-3-4-11(18)8-12/h2-10H,1H2,(H,21,23)(H,19,20,22)
InChI key:InChIKey=HTUBKQUPEREOGA-UHFFFAOYSA-N
SMILES:O=C(C=C)NC=1C=CC2=NC=NC(NC=3C=CC=C(Br)C3)=C2C1
- Synonyms:
- N-[4-[(3-Bromophenyl)amino]-6-quinazolinyl]-2-propenamide
- Pd 168393
- 2-Propenamide, N-[4-[(3-bromophenyl)amino]-6-quinazolinyl]-