CymitQuimica logo

CAS 1945-63-7

:

(E)-2-{4-[2-(diaminomethylidene)hydrazinyl]phenyl}diazenecarboximidamide

Description:
(E)-2-{4-[2-(diaminomethylidene)hydrazinyl]phenyl}diazenecarboximidamide, identified by its CAS number 1945-63-7, is a chemical compound characterized by its complex structure, which includes a diazenecarboximidamide moiety and a hydrazine derivative. This compound features a diazene functional group, which is characterized by the presence of a nitrogen-nitrogen double bond, contributing to its reactivity and potential applications in various fields, including medicinal chemistry. The presence of the diaminomethylidene group suggests that it may exhibit interesting biological properties, potentially acting as a ligand or a precursor in the synthesis of more complex molecules. The compound's hydrophilicity and solubility can be influenced by the functional groups present, affecting its behavior in biological systems. Additionally, the structural arrangement may allow for specific interactions with biological targets, making it a candidate for further investigation in drug development or as a biochemical probe. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical reactivity.
Formula:C8H12N8
InChI:InChI=1/C8H12N8/c9-7(10)15-13-5-1-2-6(4-3-5)14-16-8(11)12/h1-4,13H,(H3,11,12)(H4,9,10,15)/b16-14+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.