CAS 19456-83-8
:4,4-Dimethyl-5α-cholesta-8,14-dien-3β-ol
Description:
4,4-Dimethyl-5α-cholesta-8,14-dien-3β-ol, with the CAS number 19456-83-8, is a sterol compound that belongs to the class of steroids. It features a complex polycyclic structure characteristic of cholesterol derivatives, including a hydroxyl group at the 3β position and double bonds at the 8 and 14 positions. This compound is notable for its two methyl groups at the 4 position, which can influence its biological activity and solubility. It is typically found in certain plant and animal tissues and may play a role in cellular processes, including membrane fluidity and signaling pathways. The presence of the double bonds and hydroxyl group contributes to its reactivity and potential interactions with other biomolecules. As a sterol, it may also be involved in the synthesis of hormones and vitamins. Its specific applications and biological significance can vary, making it a subject of interest in biochemistry and pharmacology.
Formula:C29H48O
InChI:InChI=1S/C29H48O/c1-19(2)9-8-10-20(3)22-12-13-23-21-11-14-25-27(4,5)26(30)16-18-29(25,7)24(21)15-17-28(22,23)6/h13,19-20,22,25-26,30H,8-12,14-18H2,1-7H3/t20-,22-,25+,26+,28-,29-/m1/s1
InChI key:InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
SMILES:C[C@@]12C3=C(C=4[C@](C)(CC3)[C@@]([C@@H](CCCC(C)C)C)(CC4)[H])CC[C@]1(C(C)(C)[C@@H](O)CC2)[H]
Synonyms:- (3Beta,5Alpha)-4,4-Dimethylcholesta-8,14-Dien-3-Ol
- (3β,5α)-4,4-Dimethylcholesta-8,14-dien-3-ol
- 4,4-Dcdo
- 4,4-Dimethyl-5alpha-cholesta-8,14-diene-3beta-ol
- 4,4-Dimethyl-5α-cholesta-8,14-dien-3β-ol
- 5α-Cholesta-8,14-dien-3β-ol, 4,4-dimethyl-
- Cholesta-8,14-dien-3-ol, 4,4-dimethyl-, (3beta,5alpha)-
- Cholesta-8,14-dien-3-ol, 4,4-dimethyl-, (3β,5α)-
- Mas 412
- 4,4-Dimethylcholesta-8,14-dien-3-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(3β,5α)-4,4-Dimethylcholesta-8,14-dien-3-ol
CAS:Controlled ProductFormula:C29H48OColor and Shape:NeatMolecular weight:412.691
