CymitQuimica logo

CAS 1946-00-5

:

Limonene-1,2-diol

Description:
Limonene-1,2-diol, with the CAS number 1946-00-5, is a bicyclic monoterpene alcohol derived from limonene, a common component of citrus oils. This compound features two hydroxyl (-OH) groups, which contribute to its solubility in water and its reactivity in various chemical processes. Limonene-1,2-diol is characterized by its pleasant citrus aroma, making it valuable in the fragrance and flavor industries. It exhibits antimicrobial properties, which can be beneficial in cosmetic and cleaning formulations. Additionally, it serves as a chiral building block in organic synthesis, allowing for the production of various pharmaceuticals and agrochemicals. The compound is generally regarded as safe for use in food and cosmetic applications, although its safety profile should always be evaluated in specific contexts. Its physical properties, such as boiling point and density, can vary based on purity and environmental conditions. Overall, limonene-1,2-diol is a versatile compound with applications across multiple industries due to its unique chemical structure and properties.
Formula:C10H18O2
InChI:InChI=1S/C10H18O2/c1-7(2)8-4-5-10(3,12)9(11)6-8/h8-9,11-12H,1,4-6H2,2-3H3
InChI key:InChIKey=WKZWTZTZWGWEGE-UHFFFAOYSA-N
SMILES:C(C)(=C)C1CC(O)C(C)(O)CC1
Synonyms:
  • 1,2-Cyclohexanediol, 1-methyl-4-(1-methylethenyl)-
  • p-Menth-8-ene-1,2-diol
  • 8-p-Menthene-1,2-diol
  • 1-Methyl-4-(1-methylethenyl)-1,2-cyclohexanediol
  • 8,9-p-Menthen-1,2-diol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.