CAS 1946010-82-7

2-Pyrrolidineethanamine, 1-methyl-, hydrochloride (1:2), (2R)-

Description:

2-Pyrrolidineethanamine, 1-methyl-, hydrochloride (1:2), (2R)-, is a chemical compound characterized by its structural features, which include a pyrrolidine ring and an ethylamine side chain. This compound is a chiral amine, with the (2R) designation indicating its specific stereochemistry. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in various applications, particularly in pharmaceuticals. The presence of the methyl group on the nitrogen atom contributes to its basicity and potential interactions with biological systems. This compound may exhibit properties relevant to neurotransmitter modulation, making it of interest in medicinal chemistry and drug development. Its CAS number, 1946010-82-7, allows for precise identification in chemical databases. Safety and handling considerations should be observed, as with all amines and their derivatives, due to potential reactivity and toxicity. Overall, 2-Pyrrolidineethanamine, 1-methyl-, hydrochloride is a compound with significant implications in research and therapeutic contexts.

Formula: C₇H₁₆N₂·2ClH

InChI: InChI=1S/C7H16N2.2ClH/c1-9-6-2-3-7(9)4-5-8;;/h7H,2-6,8H2,1H3;2*1H/t7-;;/m1../s1

InChI key: InChIKey=PGWNJCHXKFIPLD-XCUBXKJBSA-N

SMILES: C(CN)[C@@H]1N(C)CCC1.Cl

Synonyms:

• 2-Pyrrolidineethanamine, 1-methyl-, hydrochloride (1:2), (2R)-

2-[(2R)-1-methylpyrrolidin-2-yl]ethan-1-amine dihydrochloride

CAS: 1946010-82-7

Formula: C₇H₁₈Cl₂N₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 201.1372

Ref: IN-DA01DXBG

2-[(2R)-1-Methylpyrrolidin-2-yl]ethan-1-amine dihydrochloride

CAS: 1946010-82-7

Purity: 95%

Molecular weight: 201.1399994

Ref: 10-F625397